The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-6-((3-(dimethylamino)propyl)amino)-7-fluoro-3-(4-phenoxybenzylidene)-2,3-dihydropyrrolo[2,1-b]quinazolin-9(1H)-one ID: ALA4065975
PubChem CID: 137632617
Max Phase: Preclinical
Molecular Formula: C29H29FN4O2
Molecular Weight: 484.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)CCCNc1cc2nc3n(c(=O)c2cc1F)CC/C3=C\c1ccc(Oc2ccccc2)cc1
Standard InChI: InChI=1S/C29H29FN4O2/c1-33(2)15-6-14-31-27-19-26-24(18-25(27)30)29(35)34-16-13-21(28(34)32-26)17-20-9-11-23(12-10-20)36-22-7-4-3-5-8-22/h3-5,7-12,17-19,31H,6,13-16H2,1-2H3/b21-17+
Standard InChI Key: RRJLJVIFGJVDRR-HEHNFIMWSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
10.5753 -6.2523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8266 -7.0324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6228 -7.2055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8748 -7.9814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6743 -8.1545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2201 -7.5517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9703 -6.7716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1743 -6.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9695 -5.1838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9683 -5.9992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6805 -6.4081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6787 -4.7749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3832 -5.1802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3862 -6.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0882 -6.4057 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0906 -4.7727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0906 -3.9555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2562 -6.4155 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5405 -6.0063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8366 -6.4185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7994 -5.1827 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8020 -6.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0558 -5.5962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5778 -4.9302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2544 -4.7736 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.1264 -6.0142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4212 -6.4271 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7110 -6.0229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4262 -7.2443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0189 -7.7244 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2686 -8.5025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7166 -9.1060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9658 -9.8834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7653 -10.0568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3152 -9.4465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0630 -8.6714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
9 10 2 0
10 11 1 0
11 14 2 0
13 12 2 0
12 9 1 0
13 14 1 0
13 16 1 0
14 15 1 0
15 22 2 0
21 16 1 0
16 17 2 0
10 18 1 0
18 19 1 0
19 20 1 0
21 22 1 0
22 1 1 0
1 23 1 0
23 24 1 0
24 21 1 0
9 25 1 0
20 26 1 0
26 27 1 0
27 28 1 0
27 29 1 0
6 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 484.58Molecular Weight (Monoisotopic): 484.2275AlogP: 5.64#Rotatable Bonds: 8Polar Surface Area: 59.39Molecular Species: BASEHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.40CX LogP: 4.47CX LogD: 2.48Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.33Np Likeness Score: -0.96
References 1. Wang YQ, Huang ZL, Chen SB, Wang CX, Shan C, Yin QK, Ou TM, Li D, Gu LQ, Tan JH, Huang ZS.. (2017) Design, Synthesis, and Evaluation of New Selective NM23-H2 Binders as c-MYC Transcription Inhibitors via Disruption of the NM23-H2/G-Quadruplex Interaction., 60 (16): [PMID:28714689 ] [10.1021/acs.jmedchem.7b00421 ]