The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3-Acrylamido-4-methylphenylamino)-N-(2-methyl-5-(3,4,5-trimethoxybenzamido)phenyl)-4-(methylamino)pyrimidine-5-carboxamide ID: ALA4066104
PubChem CID: 122633900
Max Phase: Preclinical
Molecular Formula: C33H35N7O6
Molecular Weight: 625.69
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1cc(Nc2ncc(C(=O)Nc3cc(NC(=O)c4cc(OC)c(OC)c(OC)c4)ccc3C)c(NC)n2)ccc1C
Standard InChI: InChI=1S/C33H35N7O6/c1-8-28(41)38-24-16-22(12-10-18(24)2)37-33-35-17-23(30(34-4)40-33)32(43)39-25-15-21(11-9-19(25)3)36-31(42)20-13-26(44-5)29(46-7)27(14-20)45-6/h8-17H,1H2,2-7H3,(H,36,42)(H,38,41)(H,39,43)(H2,34,35,37,40)
Standard InChI Key: XURALSVDCFXBAX-UHFFFAOYSA-N
Molfile:
RDKit 2D
46 49 0 0 0 0 0 0 0 0999 V2000
37.6068 -2.6208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.6057 -3.4481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3205 -3.8610 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.0370 -3.4477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0341 -2.6172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3188 -2.2080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7470 -2.2019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4631 -2.6118 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.7440 -1.3769 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.1760 -2.1966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7521 -3.8590 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.7533 -4.6840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8904 -2.6098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6028 -2.1953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6002 -1.3695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8791 -0.9598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1697 -1.3767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4521 -0.9697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8910 -3.8601 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.8903 -4.6851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1754 -5.0954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1744 -5.9197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8890 -6.3335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6062 -5.9172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6037 -5.0943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8894 -7.1586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3218 -6.3278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.3186 -2.6055 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.0317 -2.1906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.7476 -2.6008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0290 -1.3656 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.7457 -3.4261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.4608 -3.8362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.4539 -2.1857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0352 -5.9133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7507 -6.3239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0329 -5.0884 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.7530 -7.1489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.1695 -2.5920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.1707 -3.4168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.8821 -2.1764 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
46.8786 -1.3514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.4660 -4.6611 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.7542 -5.0782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.8875 -3.8252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
46.8922 -4.6502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
7 9 2 0
8 10 1 0
4 11 1 0
11 12 1 0
10 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 10 1 0
17 18 1 0
2 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
23 26 1 0
24 27 1 0
14 28 1 0
28 29 1 0
29 30 1 0
29 31 2 0
30 32 2 0
32 33 1 0
33 40 2 0
39 34 2 0
34 30 1 0
27 35 1 0
35 36 1 0
35 37 2 0
36 38 2 0
39 40 1 0
39 41 1 0
41 42 1 0
33 43 1 0
43 44 1 0
40 45 1 0
45 46 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 625.69Molecular Weight (Monoisotopic): 625.2649AlogP: 5.53#Rotatable Bonds: 12Polar Surface Area: 164.83Molecular Species: NEUTRALHBA: 10HBD: 5#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 5#RO5 Violations (Lipinski): 3CX Acidic pKa: 12.79CX Basic pKa: 4.81CX LogP: 5.62CX LogD: 5.62Aromatic Rings: 4Heavy Atoms: 46QED Weighted: 0.13Np Likeness Score: -0.96
References 1. Liang X, Lv F, Wang B, Yu K, Wu H, Qi Z, Jiang Z, Chen C, Wang A, Miao W, Wang W, Hu Z, Liu J, Liu X, Zhao Z, Wang L, Zhang S, Ye Z, Wang C, Ren T, Wang Y, Liu Q, Liu J.. (2017) Discovery of 2-((3-Acrylamido-4-methylphenyl)amino)-N-(2-methyl-5-(3,4,5-trimethoxybenzamido)phenyl)-4-(methylamino)pyrimidine-5-carboxamide (CHMFL-BMX-078) as a Highly Potent and Selective Type II Irreversible Bone Marrow Kinase in the X Chromosome (BMX) Kinase Inhibitor., 60 (5): [PMID:28140585 ] [10.1021/acs.jmedchem.6b01413 ] 2. Wang L, Zhao J, Yao Y, Wang C, Zhang J, Shu X, Sun X, Li Y, Liu K, Yuan H, Ma X.. (2017) Covalent binding design strategy: A prospective method for discovery of potent targeted anticancer agents., 142 [PMID:28986130 ] [10.1016/j.ejmech.2017.09.024 ]