The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(1-Ethyl-1H-indol-3-yl)-1-(4-methoxyphenyl)benzo[f][1,7]naphthyridine ID: ALA4066359
PubChem CID: 137632820
Max Phase: Preclinical
Molecular Formula: C29H23N3O
Molecular Weight: 429.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCn1cc(-c2cc(-c3ccc(OC)cc3)c3c(cnc4ccccc43)n2)c2ccccc21
Standard InChI: InChI=1S/C29H23N3O/c1-3-32-18-24(21-8-5-7-11-28(21)32)26-16-23(19-12-14-20(33-2)15-13-19)29-22-9-4-6-10-25(22)30-17-27(29)31-26/h4-18H,3H2,1-2H3
Standard InChI Key: IULADXPHKPNSAH-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 38 0 0 0 0 0 0 0 0999 V2000
24.2295 -5.9514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2284 -6.7710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9364 -7.1799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9347 -5.5426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6433 -5.9478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6440 -6.7668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3526 -7.1739 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.0608 -6.7631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3470 -5.5376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0526 -5.9396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7515 -5.5296 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.7460 -4.7177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0357 -4.3176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3397 -4.7299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6313 -4.3317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6243 -3.5134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9134 -3.1120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2088 -3.5278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2198 -4.3492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9313 -4.7468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4467 -4.3040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4965 -3.1274 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.4871 -2.3102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1911 -4.6276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7297 -4.0176 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.5432 -4.0951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8829 -4.8384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5217 -3.4938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3163 -3.3196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5611 -2.5458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0124 -1.9456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2157 -2.1244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9745 -2.8979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 10 1 0
9 5 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 9 2 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
14 15 1 0
12 21 1 0
18 22 1 0
22 23 1 0
21 24 2 0
24 25 1 0
25 29 1 0
28 21 1 0
25 26 1 0
26 27 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 429.52Molecular Weight (Monoisotopic): 429.1841AlogP: 7.10#Rotatable Bonds: 4Polar Surface Area: 39.94Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 4.07CX LogP: 6.49CX LogD: 6.49Aromatic Rings: 6Heavy Atoms: 33QED Weighted: 0.28Np Likeness Score: -0.79
References 1. Arepalli SK, Park B, Lee K, Jo H, Jun KY, Kwon Y, Kang JS, Jung JK, Lee H.. (2017) Design, synthesis and biological evaluation of 1,3-diphenylbenzo[f][1,7]naphthyrdines., 25 (20): [PMID:28870801 ] [10.1016/j.bmc.2017.08.030 ]