The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R,3R,4R,5R)-2-(acetoxymethyl)-5-(4-((N-hexylmethylsulfonamido)methyl)-1H-1,2,3-triazol-1-yl)tetrahydrofuran-3,4-diyl diacetate ID: ALA4066493
PubChem CID: 137633950
Max Phase: Preclinical
Molecular Formula: C21H34N4O9S
Molecular Weight: 518.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCN(Cc1cn([C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H]2OC(C)=O)nn1)S(C)(=O)=O
Standard InChI: InChI=1S/C21H34N4O9S/c1-6-7-8-9-10-24(35(5,29)30)11-17-12-25(23-22-17)21-20(33-16(4)28)19(32-15(3)27)18(34-21)13-31-14(2)26/h12,18-21H,6-11,13H2,1-5H3/t18-,19-,20-,21-/m1/s1
Standard InChI Key: YOVBSMZYYWSVSN-XRXFAXGQSA-N
Molfile:
RDKit 2D
35 36 0 0 0 0 0 0 0 0999 V2000
15.3582 -4.9125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9499 -5.6291 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.7747 -5.6244 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5666 -6.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3916 -6.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6483 -5.9242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9791 -5.4374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3140 -5.9242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4333 -5.6703 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8756 -7.3764 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0808 -7.3751 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5293 -5.6696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9165 -6.2219 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1317 -5.9673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5188 -6.5197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9598 -5.1604 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4153 -8.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9295 -8.7960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2357 -8.2165 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6963 -7.2910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1804 -7.9591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0327 -6.5377 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1023 -6.1528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7705 -5.6688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5166 -4.8838 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6917 -4.8828 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.5548 -5.9248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1686 -5.3736 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9982 -4.5665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1232 -6.4369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2140 -4.3105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0435 -3.5032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2592 -3.2472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0888 -2.4400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3046 -2.1840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 4 1 0
6 9 1 1
5 10 1 6
4 11 1 6
8 12 1 1
12 13 1 0
13 14 1 0
14 15 1 0
14 16 2 0
11 17 1 0
17 18 1 0
17 19 2 0
10 20 1 0
20 21 1 0
20 22 2 0
9 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 9 1 0
24 27 1 0
27 28 1 0
28 2 1 0
28 29 1 0
2 30 1 0
29 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 518.59Molecular Weight (Monoisotopic): 518.2046AlogP: 0.94#Rotatable Bonds: 13Polar Surface Area: 156.22Molecular Species: NEUTRALHBA: 12HBD: ┄#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 0.52CX LogD: 0.52Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.21Np Likeness Score: -0.06
References 1. Alaoui S, Dufies M, Driowya M, Demange L, Bougrin K, Robert G, Auberger P, Pagès G, Benhida R.. (2017) Synthesis and anti-cancer activities of new sulfonamides 4-substituted-triazolyl nucleosides., 27 (9): [PMID:28325600 ] [10.1016/j.bmcl.2017.03.018 ]