(+)-(2R)-1,2-Dibenzyl-4-(3-phenylpropyl)-1,4-diazepane

ID: ALA4066655

PubChem CID: 137633205

Max Phase: Preclinical

Molecular Formula: C28H34N2

Molecular Weight: 398.59

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  c1ccc(CCCN2CCCN(Cc3ccccc3)[C@H](Cc3ccccc3)C2)cc1

Standard InChI:  InChI=1S/C28H34N2/c1-4-12-25(13-5-1)18-10-19-29-20-11-21-30(23-27-16-8-3-9-17-27)28(24-29)22-26-14-6-2-7-15-26/h1-9,12-17,28H,10-11,18-24H2/t28-/m1/s1

Standard InChI Key:  OEDKVALKSDLTND-MUUNZHRXSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   24.9103  -10.0318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6519   -9.6887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3905  -10.0513    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.7152  -10.8324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5671  -10.8520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2234  -11.4815    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.0457  -11.4873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3968  -12.2313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2149  -12.2290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6221  -12.9392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4395  -12.9372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8494  -12.2265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4319  -11.5162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6159  -11.5217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8630  -12.2149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0452  -12.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6439  -11.4946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8269  -11.4877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4116  -12.1932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8192  -12.9070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6348  -12.9104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0332   -9.5466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7916   -9.8509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4343   -9.3462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1927   -9.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3049  -10.4600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0625  -10.7643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7062  -10.2594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5873   -9.4466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8296   -9.1461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  1  4  1  0
  3  5  1  0
  4  6  1  0
  5  7  1  0
  6  7  1  0
  7  8  1  1
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  6 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  3 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4066655

    ---

Associated Targets(non-human)

SIGMAR1 Sigma-1 receptor (3326 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Tmem97 Sigma intracellular receptor 2 (922 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ERG2 C-8 sterol isomerase (237 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 398.59Molecular Weight (Monoisotopic): 398.2722AlogP: 5.44#Rotatable Bonds: 8
Polar Surface Area: 6.48Molecular Species: BASEHBA: 2HBD:
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 10.00CX LogP: 6.35CX LogD: 3.80
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.50Np Likeness Score: -0.76

References

1. Fanter L, Müller C, Schepmann D, Bracher F, Wünsch B..  (2017)  Chiral-pool synthesis of 1,2,4-trisubstituted 1,4-diazepanes as novel σ1 receptor ligands.,  25  (17): [PMID:28764962] [10.1016/j.bmc.2017.07.027]

Source