The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(+/-)-N-((6,6-diphenyl-1,4-dioxan-2-yl)methyl)-2-(2-nitrophenoxy)ethanamine ID: ALA4067083
PubChem CID: 137631359
Max Phase: Preclinical
Molecular Formula: C25H26N2O5
Molecular Weight: 434.49
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=[N+]([O-])c1ccccc1OCCNCC1COCC(c2ccccc2)(c2ccccc2)O1
Standard InChI: InChI=1S/C25H26N2O5/c28-27(29)23-13-7-8-14-24(23)31-16-15-26-17-22-18-30-19-25(32-22,20-9-3-1-4-10-20)21-11-5-2-6-12-21/h1-14,22,26H,15-19H2
Standard InChI Key: VFNSXXVAZKMPQN-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
27.8645 -20.5847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0449 -19.7749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1453 -19.7768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5475 -18.9852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5463 -19.7812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2341 -20.1784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9233 -19.7807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9206 -18.9817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2323 -18.5881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8587 -20.1775 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.1716 -19.7801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4839 -20.1764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7968 -19.7790 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.1091 -20.1753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4221 -19.7779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4225 -18.9865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7394 -18.5893 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.0494 -18.9821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7344 -20.1785 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.0712 -20.8310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8906 -21.6400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5020 -22.2019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2967 -21.9495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4736 -21.1411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6993 -18.9966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8005 -18.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3514 -19.7787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8077 -20.5594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7049 -20.5541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8593 -18.5887 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.1720 -18.9857 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.8591 -17.7949 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
5 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
15 14 1 0
15 16 1 0
15 19 1 0
16 17 1 0
17 18 1 0
18 2 1 0
2 19 1 0
1 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 1 1 0
3 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 3 1 0
30 31 2 0
30 32 1 0
4 30 1 0
M CHG 2 30 1 32 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 434.49Molecular Weight (Monoisotopic): 434.1842AlogP: 3.92#Rotatable Bonds: 9Polar Surface Area: 82.86Molecular Species: BASEHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.81CX LogP: 4.48CX LogD: 3.06Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.31Np Likeness Score: -0.35
References 1. Del Bello F, Bonifazi A, Giannella M, Giorgioni G, Piergentili A, Petrelli R, Cifani C, Micioni Di Bonaventura MV, Keck TM, Mazzolari A, Vistoli G, Cilia A, Poggesi E, Matucci R, Quaglia W.. (2017) The replacement of the 2-methoxy substituent of N-((6,6-diphenyl-1,4-dioxan-2-yl)methyl)-2-(2-methoxyphenoxy)ethan-1-amine improves the selectivity for 5-HT1A receptor over α1-adrenoceptor and D2-like receptor subtypes., 125 [PMID:27662034 ] [10.1016/j.ejmech.2016.09.026 ]