The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl 3-carbamoyl-2-(4-(morpholinomethyl)benzamido)-4,5,6,7-tetrahydrobenzo[b]thiophene-6-carboxylate ID: ALA4067164
PubChem CID: 137631365
Max Phase: Preclinical
Molecular Formula: C24H29N3O5S
Molecular Weight: 471.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)C1CCc2c(sc(NC(=O)c3ccc(CN4CCOCC4)cc3)c2C(N)=O)C1
Standard InChI: InChI=1S/C24H29N3O5S/c1-2-32-24(30)17-7-8-18-19(13-17)33-23(20(18)21(25)28)26-22(29)16-5-3-15(4-6-16)14-27-9-11-31-12-10-27/h3-6,17H,2,7-14H2,1H3,(H2,25,28)(H,26,29)
Standard InChI Key: HMWWISUHIQOXJZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
4.4078 -22.8566 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.6622 -22.0799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9993 -21.5978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9980 -20.7806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7051 -20.3709 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2897 -20.3731 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4398 -21.8285 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0463 -22.3761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8238 -22.1247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8753 -23.1752 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4263 -22.6744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2032 -22.4235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3748 -21.6236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7634 -21.0751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9888 -21.3289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5907 -22.8566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3390 -22.0843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5487 -21.9169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0044 -22.5191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2560 -23.2915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0520 -23.4617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1520 -21.3712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7593 -21.9180 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5851 -22.7147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1884 -23.2606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9672 -23.0120 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1393 -22.2122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5325 -21.6609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7091 -23.8986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9098 -23.7286 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9614 -24.6759 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3628 -24.3357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4365 -24.1656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16 1 1 0
1 2 1 0
2 3 2 0
3 17 1 0
3 4 1 0
4 5 1 0
4 6 2 0
2 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
9 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 9 1 0
16 17 2 0
16 21 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
13 22 1 0
22 23 1 0
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
20 29 1 0
29 30 1 0
29 31 2 0
30 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 471.58Molecular Weight (Monoisotopic): 471.1828AlogP: 2.60#Rotatable Bonds: 7Polar Surface Area: 110.96Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.86CX Basic pKa: 6.60CX LogP: 3.55CX LogD: 3.48Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.60Np Likeness Score: -1.61
References 1. Llona-Minguez S, Fayezi S, Alihemmati A, Juárez-Jiménez J, Piedrafita FJ, Helleday T.. (2017) Tetrahydrobenzothiophene carboxamides: Beyond the kinase domain and into the fatty acid realm., 27 (18): [PMID:28807439 ] [10.1016/j.bmcl.2017.08.006 ]