(S)-4-benzyl-1-(4-((S)-2-(2-cyclopentylethyl)-4,5-dihydro-1H-imidazol-4-yl)butyl)-3-phenethylimidazolidine-2-thione

ID: ALA4067306

PubChem CID: 137633035

Max Phase: Preclinical

Molecular Formula: C32H44N4S

Molecular Weight: 516.80

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  S=C1N(CCCC[C@H]2CNC(CCC3CCCC3)=N2)C[C@H](Cc2ccccc2)N1CCc1ccccc1

Standard InChI:  InChI=1S/C32H44N4S/c37-32-35(21-10-9-17-29-24-33-31(34-29)19-18-26-13-7-8-14-26)25-30(23-28-15-5-2-6-16-28)36(32)22-20-27-11-3-1-4-12-27/h1-6,11-12,15-16,26,29-30H,7-10,13-14,17-25H2,(H,33,34)/t29-,30-/m0/s1

Standard InChI Key:  XJCMSTRNBCVOHG-KYJUHHDHSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   12.6494  -12.2456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4658  -12.2089    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.6850  -11.4216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0011  -10.9697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3647  -11.4809    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2538  -12.9604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4505  -11.1355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0810  -11.6553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8465  -11.3692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4770  -11.8891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2425  -11.6030    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.9225  -12.0547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5621  -11.5460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2760  -10.7805    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.4596  -10.8162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9505  -10.1770    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   19.3496  -11.7645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4866  -12.5704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8570  -13.0867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9935  -13.8916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7604  -14.1765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3911  -13.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2514  -12.8474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7271  -10.0991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5427  -10.1490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9533   -9.4424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7696   -9.4464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1801   -8.7406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7734   -8.0308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9520   -8.0311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5452   -8.7374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4367  -12.9753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0411  -13.6903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2332  -13.7908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0779  -14.5931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7930  -14.9888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3901  -14.4309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  1  6  1  0
  3  7  1  6
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 15 16  2  0
 13 17  1  1
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 14 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
  6 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4067306

    ---

Associated Targets(Human)

RORA Tchem Nuclear receptor ROR-alpha (562 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rorb Nuclear receptor ROR-beta (15 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Rorc Nuclear receptor ROR-gamma (89407 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 516.80Molecular Weight (Monoisotopic): 516.3287AlogP: 6.25#Rotatable Bonds: 13
Polar Surface Area: 30.87Molecular Species: BASEHBA: 3HBD: 1
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 10.45CX LogP: 6.92CX LogD: 4.59
Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.25Np Likeness Score: -0.16

References

1. Nefzi A, Marconi GD, Ortiz MA, Davis JC, Piedrafita FJ..  (2017)  Synthesis of dihydroimidazole tethered imidazolinethiones and their activity as novel antagonists of the nuclear retinoic acid receptor-related orphan receptors (RORs).,  27  (7): [PMID:28242276] [10.1016/j.bmcl.2017.02.014]

Source