The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
sodium-(5S,8S)-1-(3-Chlorophenyl)-5-(cyclohexylmethyl)-3,6,11-trioxo-8-(((S)-2-oxopyrrolidin-3-yl)methyl)-2,10-dioxa-4,7-diazaoctadecane-9-sulfonate ID: ALA4067510
PubChem CID: 137631750
Max Phase: Preclinical
Molecular Formula: C32H47ClN3NaO9S
Molecular Weight: 686.27
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCC(=O)OC([C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC1CCCCC1)NC(=O)OCc1cccc(Cl)c1)S(=O)(=O)[O-].[Na+]
Standard InChI: InChI=1S/C32H48ClN3O9S.Na/c1-2-3-4-5-9-15-28(37)45-31(46(41,42)43)27(20-24-16-17-34-29(24)38)35-30(39)26(19-22-11-7-6-8-12-22)36-32(40)44-21-23-13-10-14-25(33)18-23;/h10,13-14,18,22,24,26-27,31H,2-9,11-12,15-17,19-21H2,1H3,(H,34,38)(H,35,39)(H,36,40)(H,41,42,43);/q;+1/p-1/t24-,26-,27-,31?;/m0./s1
Standard InChI Key: YFPONUIXECFWSY-VOALEFPISA-M
Molfile:
RDKit 2D
48 49 0 0 0 0 0 0 0 0999 V2000
3.5881 0.4613 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1794 1.1756 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.7680 0.4653 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.4041 1.1421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4058 0.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6922 -0.0989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9762 0.3132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9763 1.1434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6908 1.5534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2656 1.5583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5501 1.1515 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8354 1.5664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1178 1.1499 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8400 2.3882 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4057 1.5754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3097 1.1645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4104 2.4013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3045 2.8163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3145 0.3427 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0315 1.5737 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7548 1.1674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4697 1.5824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7595 0.3415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4749 -0.0695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5657 -0.8839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3757 -1.0637 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7806 -0.3397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2302 0.2710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9556 -1.4390 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4651 2.4042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1799 2.8191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1752 3.6451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9000 1.5864 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8953 2.4081 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6854 -0.3086 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1.0199 2.4019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7326 2.8133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7350 3.6402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0183 4.0540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2994 3.6409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6925 -0.9206 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.8845 4.0600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5986 3.6531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3078 4.0680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0219 3.6612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7312 4.0762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4452 3.6693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6270 1.0795 0.0000 Na 0 0 0 0 0 15 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
13 15 1 0
15 16 1 0
15 17 1 1
17 18 1 0
16 19 2 0
16 20 1 0
20 21 1 0
21 22 1 0
21 23 1 6
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
24 28 1 0
25 29 2 0
22 2 1 0
22 30 1 0
30 31 1 0
31 32 1 0
2 33 1 0
31 34 2 0
24 35 1 1
18 36 1 0
18 40 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
6 41 1 0
32 42 1 0
42 43 1 0
43 44 1 0
44 45 1 0
45 46 1 0
46 47 1 0
M CHG 2 33 -1 48 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 686.27Molecular Weight (Monoisotopic): 685.2800AlogP: 5.03#Rotatable Bonds: 18Polar Surface Area: 177.20Molecular Species: ACIDHBA: 8HBD: 4#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 3CX Acidic pKa: -0.87CX Basic pKa: ┄CX LogP: 4.31CX LogD: 3.00Aromatic Rings: 1Heavy Atoms: 46QED Weighted: 0.09Np Likeness Score: 0.05
References 1. Galasiti Kankanamalage AC, Kim Y, Rathnayake AD, Alliston KR, Butler MM, Cardinale SC, Bowlin TL, Groutas WC, Chang KO.. (2017) Design, Synthesis, and Evaluation of Novel Prodrugs of Transition State Inhibitors of Norovirus 3CL Protease., 60 (14): [PMID:28671827 ] [10.1021/acs.jmedchem.7b00497 ]