(8R,9S,10R,13S,14S,16S,E)-17-ethylidene-16-(4-(4-fluorophenyl)-1H-1,2,3-triazol-1-yl)-10,13-dimethyl-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3(2H)-one

ID: ALA4067560

PubChem CID: 137633423

Max Phase: Preclinical

Molecular Formula: C29H34FN3O

Molecular Weight: 459.61

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C/C=C1/[C@@H](n2cc(-c3ccc(F)cc3)nn2)C[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C

Standard InChI:  InChI=1S/C29H34FN3O/c1-4-23-27(33-17-26(31-32-33)18-5-8-20(30)9-6-18)16-25-22-10-7-19-15-21(34)11-13-28(19,2)24(22)12-14-29(23,25)3/h4-6,8-9,15,17,22,24-25,27H,7,10-14,16H2,1-3H3/b23-4-/t22-,24+,25+,27+,28+,29-/m1/s1

Standard InChI Key:  ZUDSQPQMUVSUJX-UESWEDANSA-N

Molfile:  

     RDKit          2D

 37 42  0  0  0  0  0  0  0  0999 V2000
    3.0624  -11.6181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0624  -12.4395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7677  -12.8439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7677  -11.2013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4771  -11.6181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4736  -12.4395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1798  -12.8488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8940  -12.4455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1867  -11.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8975  -11.6290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9143   -9.9811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1921  -10.3830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6250  -10.3997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6117  -11.2225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3904  -11.4924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8866  -10.8337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4119  -10.1594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7023  -10.8461    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1719  -11.5190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9572  -11.2750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9705  -10.4537    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1933  -10.1887    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6770   -9.3823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1402   -8.7621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6201   -9.5752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6036  -12.0433    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8896  -10.8051    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.1797  -12.0267    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4698  -10.7968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3512  -12.8491    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6142  -11.7666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5142  -12.5829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1707  -13.0737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9235  -12.7536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0242  -11.9337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3666  -11.4424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5816  -13.2478    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  2  0
  5  4  1  0
  5  6  1  0
  5  9  1  0
  6  7  1  0
  7  8  1  0
  8 10  1  0
  9 10  1  0
  9 12  1  0
 10 14  1  0
 13 11  1  0
 11 12  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 13  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 18  1  0
 16 18  1  1
 17 23  2  0
 23 24  1  0
 13 25  1  1
 14 26  1  6
 10 27  1  1
  9 28  1  6
  5 29  1  1
  2 30  2  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
 20 31  1  0
 34 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4067560

    ---

Associated Targets(non-human)

LLC-PK1 (2135 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 459.61Molecular Weight (Monoisotopic): 459.2686AlogP: 6.71#Rotatable Bonds: 2
Polar Surface Area: 47.78Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 6.41CX LogD: 6.41
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.47Np Likeness Score: 0.73

References

1. Lee D, Kim T, Kim KH, Ham J, Jang TS, Kang KS, Lee JW..  (2017)  Evaluation of guggulsterone derivatives as novel kidney cell protective agents against cisplatin-induced nephrotoxicity.,  27  (14): [PMID:28552338] [10.1016/j.bmcl.2017.05.033]

Source