(S)-2-(3-(1,4-dimethyl-1H-1,2,3-triazol-5-yl)-6-fluoro-5-(phenyl(tetrahydro-2H-pyran-4-yl)methyl)-5H-pyrido[3,2-b]indol-7-yl)propan-2-ol

ID: ALA4067730

PubChem CID: 118196369

Max Phase: Preclinical

Molecular Formula: C30H32FN5O2

Molecular Weight: 513.62

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1nnn(C)c1-c1cnc2c3ccc(C(C)(C)O)c(F)c3n([C@H](c3ccccc3)C3CCOCC3)c2c1

Standard InChI:  InChI=1S/C30H32FN5O2/c1-18-27(35(4)34-33-18)21-16-24-26(32-17-21)22-10-11-23(30(2,3)37)25(31)29(22)36(24)28(19-8-6-5-7-9-19)20-12-14-38-15-13-20/h5-11,16-17,20,28,37H,12-15H2,1-4H3/t28-/m1/s1

Standard InChI Key:  OYOOOLZFBKNGEJ-MUUNZHRXSA-N

Molfile:  

     RDKit          2D

 38 43  0  0  0  0  0  0  0  0999 V2000
    1.8411  -28.9253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4330  -28.2130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0202  -28.9227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1522  -26.9758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1510  -27.8029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8656  -28.2157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8638  -26.5631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5790  -26.9722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5838  -27.8030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3755  -28.0551    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3676  -26.7109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8576  -27.3793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6795  -27.2883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0119  -26.5298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5173  -25.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6972  -25.9553    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8387  -26.5524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3029  -27.2342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0948  -27.0033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1199  -26.1789    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3436  -25.9003    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1128  -25.1086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0243  -28.0104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6360  -28.8376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0886  -29.4546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4440  -29.0033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7016  -29.7848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5087  -29.9507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0571  -29.3334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7927  -28.5476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9862  -28.3855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2809  -29.2844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7343  -29.8974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9910  -30.6816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7994  -30.8493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3514  -30.2329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8646  -29.0405    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.7224  -27.8018    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  9 10  1  0
 10 12  1  0
 11  8  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 17  1  0
 14 17  1  0
 21 22  1  0
 18 23  1  0
 10 24  1  0
 24 25  1  0
 24 26  1  6
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 25 32  1  0
 25 36  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
  6 37  1  0
  5  2  1  0
  2 38  1  0
M  END

Associated Targets(Human)

NCI-H187 (598 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BRD4 Tchem Bromodomain-containing protein 4 (13122 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 513.62Molecular Weight (Monoisotopic): 513.2540AlogP: 5.68#Rotatable Bonds: 5
Polar Surface Area: 77.99Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 1.36CX LogP: 4.51CX LogD: 4.51
Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.33Np Likeness Score: -0.54

References

1. Liu Z, Wang P, Chen H, Wold EA, Tian B, Brasier AR, Zhou J..  (2017)  Drug Discovery Targeting Bromodomain-Containing Protein 4.,  60  (11): [PMID:28195723] [10.1021/acs.jmedchem.6b01761]

Source