The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-1-(2-Cyclopropylethyl)-N-(5-((2,4-dioxo-3,4-dihydroquinazolin-1(2H)-yl)methyl)-2-fluoropyridin-3-yl)pyrrolidine-3-carboxamide ID: ALA4067999
PubChem CID: 137632887
Max Phase: Preclinical
Molecular Formula: C24H26FN5O3
Molecular Weight: 451.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1cc(Cn2c(=O)[nH]c(=O)c3ccccc32)cnc1F)[C@H]1CCN(CCC2CC2)C1
Standard InChI: InChI=1S/C24H26FN5O3/c25-21-19(27-22(31)17-8-10-29(14-17)9-7-15-5-6-15)11-16(12-26-21)13-30-20-4-2-1-3-18(20)23(32)28-24(30)33/h1-4,11-12,15,17H,5-10,13-14H2,(H,27,31)(H,28,32,33)/t17-/m0/s1
Standard InChI Key: DKPPZBXQLWTONY-KRWDZBQOSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
13.6541 -14.0356 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.0881 -14.6264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3515 -14.2723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4624 -13.4661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2677 -13.3177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6334 -14.6623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6104 -15.4790 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9383 -14.2316 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4719 -14.0276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1972 -15.4383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2202 -14.6216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5252 -14.1909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8029 -14.5809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7799 -15.3976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4791 -15.8242 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8923 -15.8691 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.1079 -14.1543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1309 -13.3376 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8490 -12.9475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8762 -12.1309 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1770 -11.7001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4589 -12.0901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7638 -11.6635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0457 -12.0494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0227 -12.8661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7177 -13.2969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4358 -12.9068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2041 -10.8834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5482 -13.3742 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8736 -13.3160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6907 -13.3080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4024 -13.7093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3944 -12.8922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
1 5 1 0
6 7 2 0
6 8 1 0
3 6 1 1
1 9 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
10 15 2 0
10 16 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
18 27 1 0
22 27 2 0
21 28 2 0
19 29 2 0
17 18 1 0
13 17 1 0
8 11 1 0
9 30 1 0
30 31 1 0
32 31 1 0
33 32 1 0
31 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 451.50Molecular Weight (Monoisotopic): 451.2020AlogP: 2.33#Rotatable Bonds: 7Polar Surface Area: 100.09Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.35CX Basic pKa: 9.95CX LogP: 1.53CX LogD: -0.03Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.54Np Likeness Score: -1.57
References 1. Zhao H, Ji M, Cui G, Zhou J, Lai F, Chen X, Xu B.. (2017) Discovery of novel quinazoline-2,4(1H,3H)-dione derivatives as potent PARP-2 selective inhibitors., 25 (15): [PMID:28622906 ] [10.1016/j.bmc.2017.05.052 ]