The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8,8'-Disulfanediylbis(N-benzylquinoline-2-carboxamide) ID: ALA4068027
PubChem CID: 126599617
Max Phase: Preclinical
Molecular Formula: C34H26N4O2S2
Molecular Weight: 586.74
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCc1ccccc1)c1ccc2cccc(SSc3cccc4ccc(C(=O)NCc5ccccc5)nc34)c2n1
Standard InChI: InChI=1S/C34H26N4O2S2/c39-33(35-21-23-9-3-1-4-10-23)27-19-17-25-13-7-15-29(31(25)37-27)41-42-30-16-8-14-26-18-20-28(38-32(26)30)34(40)36-22-24-11-5-2-6-12-24/h1-20H,21-22H2,(H,35,39)(H,36,40)
Standard InChI Key: BQWVRXIGIODPRZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
23.4949 -18.3991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4937 -19.2187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2018 -19.6276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2000 -17.9903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9086 -18.3955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9094 -19.2146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6179 -19.6216 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.3262 -19.2108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3214 -18.3887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6123 -17.9853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2037 -20.4448 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.4969 -20.8551 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.4988 -21.6723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4994 -23.3026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2085 -22.8880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2035 -22.0729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7902 -22.8948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7893 -22.0820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0861 -21.6782 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.3833 -22.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3881 -22.9019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0919 -23.3020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0355 -19.6166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0386 -20.4338 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.7416 -19.2053 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.4509 -19.6111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1570 -19.1998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6739 -21.6802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6706 -20.8631 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.9679 -22.0917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.2585 -21.6860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5525 -22.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8612 -19.6085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5668 -19.1978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5641 -18.3798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8498 -17.9741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1471 -18.3871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8441 -21.6884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1385 -22.0992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1414 -22.9172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8557 -23.3228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5583 -22.9097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
3 11 1 0
11 12 1 0
12 13 1 0
13 18 2 0
17 14 2 0
14 15 1 0
15 16 2 0
16 13 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
8 23 1 0
23 24 2 0
23 25 1 0
25 26 1 0
26 27 1 0
20 28 1 0
28 29 2 0
28 30 1 0
30 31 1 0
31 32 1 0
27 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 27 1 0
32 38 2 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 586.74Molecular Weight (Monoisotopic): 586.1497AlogP: 7.44#Rotatable Bonds: 9Polar Surface Area: 83.98Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 0.69CX LogP: 7.26CX LogD: 7.26Aromatic Rings: 6Heavy Atoms: 42QED Weighted: 0.17Np Likeness Score: -0.63
References 1. Perez C, Li J, Parlati F, Rouffet M, Ma Y, Mackinnon AL, Chou TF, Deshaies RJ, Cohen SM.. (2017) Discovery of an Inhibitor of the Proteasome Subunit Rpn11., 60 (4): [PMID:28191850 ] [10.1021/acs.jmedchem.6b01379 ]