The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(1-(5-(3-(hydroxymethyl)-2,5-dimethylphenyl)pyridin-2-yl)piperidin-4-yl)acetic acid ID: ALA4068341
PubChem CID: 137631799
Max Phase: Preclinical
Molecular Formula: C21H26N2O3
Molecular Weight: 354.45
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(CO)c(C)c(-c2ccc(N3CCC(CC(=O)O)CC3)nc2)c1
Standard InChI: InChI=1S/C21H26N2O3/c1-14-9-18(13-24)15(2)19(10-14)17-3-4-20(22-12-17)23-7-5-16(6-8-23)11-21(25)26/h3-4,9-10,12,16,24H,5-8,11,13H2,1-2H3,(H,25,26)
Standard InChI Key: DZWWPVOYLWXVEH-UHFFFAOYSA-N
Molfile:
RDKit 2D
26 28 0 0 0 0 0 0 0 0999 V2000
4.7140 -10.8555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2787 -11.5499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6624 -12.2720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4811 -12.3009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9148 -11.6018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5287 -10.8826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7298 -11.6272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1154 -12.3489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9315 -12.3748 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3628 -11.6797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9722 -10.9570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1574 -10.9347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1772 -11.7012 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5632 -12.4225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3764 -12.4488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8097 -11.7556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4238 -11.0342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6045 -11.0061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6265 -11.7831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0587 -11.0896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8773 -11.1142 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6760 -10.3656 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9597 -10.1883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3303 -10.1341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7632 -9.4410 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2291 -12.9648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
5 7 1 0
13 14 1 0
13 18 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
10 13 1 0
16 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
6 23 1 0
1 24 1 0
24 25 1 0
3 26 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 354.45Molecular Weight (Monoisotopic): 354.1943AlogP: 3.55#Rotatable Bonds: 5Polar Surface Area: 73.66Molecular Species: ACIDHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.36CX Basic pKa: 6.94CX LogP: 1.96CX LogD: 1.39Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.86Np Likeness Score: -0.82
References 1. Johnson CN, Erlanson DA, Jahnke W, Mortenson PN, Rees DC.. (2018) Fragment-to-Lead Medicinal Chemistry Publications in 2016., 61 (5): [PMID:29087197 ] [10.1021/acs.jmedchem.7b01298 ]