2-(2,4-difluorophenyl)-1,1-difluoro-1-(5-((4-fluorophenyl)ethynyl)pyridin-2-yl)-3-(1H-tetrazol-1-yl)propan-2-ol

ID: ALA4068343

PubChem CID: 71621650

Max Phase: Preclinical

Molecular Formula: C23H14F5N5O

Molecular Weight: 471.39

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  OC(Cn1cnnn1)(c1ccc(F)cc1F)C(F)(F)c1ccc(C#Cc2ccc(F)cc2)cn1

Standard InChI:  InChI=1S/C23H14F5N5O/c24-17-6-3-15(4-7-17)1-2-16-5-10-21(29-12-16)23(27,28)22(34,13-33-14-30-31-32-33)19-9-8-18(25)11-20(19)26/h3-12,14,34H,13H2

Standard InChI Key:  BPGCIZWBROSBMV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
    3.5824   -2.2658    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.5866   -3.0830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2922   -2.6709    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.8767   -3.4999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1648   -3.0872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8767   -4.3212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3003   -3.4999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1625   -4.7280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1622   -5.5485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8746   -5.9621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5887   -5.5449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5856   -4.7257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1648   -2.2658    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8281   -1.7828    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5756   -1.0015    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7542   -1.0015    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4977   -1.7828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8726   -2.6786    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2978   -4.3223    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0088   -4.7308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7175   -4.3221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7149   -3.4966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0074   -3.0877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4285   -4.7238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1409   -5.1356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8533   -5.5432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8524   -6.3653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5640   -6.7770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2763   -6.3632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2725   -5.5377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5604   -5.1338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4561   -4.3171    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.8756   -6.7792    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.9854   -6.7693    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  2  1  0
  4  5  1  0
  4  6  1  0
  2  7  1  0
  6  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  6  1  0
  5 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 13  1  0
  4 18  1  0
  7 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23  7  1  0
 24 25  3  0
 21 24  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
  8 32  1  0
 10 33  1  0
 29 34  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4068343

   2-(2,4-Difluorophenyl)-1,1-difluoro-1-[5-[2-(4-fluorophenyl)ethynyl]pyridin-2-yl]-3-(tetrazol-1-yl)propan-2-ol

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 471.39

Molecular Weight (Monoisotopic): 471.1119

AlogP: 3.57

#Rotatable Bonds: 5

Polar Surface Area: 76.72

Molecular Species: NEUTRAL

HBA: 6

HBD: 1

#RO5 Violations: ┄

HBA (Lipinski): 6

HBD (Lipinski): 1

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: 10.66

CX Basic pKa: 0.32

CX LogP: 4.51

CX LogD: 4.51

Aromatic Rings: 4

Heavy Atoms: 34

QED Weighted: 0.36

Np Likeness Score: -1.52

References

1. Yates CM, Garvey EP, Shaver SR, Schotzinger RJ, Hoekstra WJ..  (2017)  Design and optimization of highly-selective, broad spectrum fungal CYP51 inhibitors.,  27  (15): [PMID:28651982] [10.1016/j.bmcl.2017.06.037]

2. Yates CM, Garvey EP, Shaver SR, Schotzinger RJ, Hoekstra WJ..  (2017)  Design and optimization of highly-selective, broad spectrum fungal CYP51 inhibitors.,  27  (15): [PMID:28651982] [10.1016/j.bmcl.2017.06.037]

3. Yates CM, Garvey EP, Shaver SR, Schotzinger RJ, Hoekstra WJ..  (2017)  Design and optimization of highly-selective, broad spectrum fungal CYP51 inhibitors.,  27  (15): [PMID:28651982] [10.1016/j.bmcl.2017.06.037]

Source

Source(1):

• Scientific Literature