The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2,4-difluorophenyl)-1,1-difluoro-1-(5-((4-fluorophenyl)ethynyl)pyridin-2-yl)-3-(1H-tetrazol-1-yl)propan-2-ol ID: ALA4068343
PubChem CID: 71621650
Max Phase: Preclinical
Molecular Formula: C23H14F5N5O
Molecular Weight: 471.39
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: OC(Cn1cnnn1)(c1ccc(F)cc1F)C(F)(F)c1ccc(C#Cc2ccc(F)cc2)cn1
Standard InChI: InChI=1S/C23H14F5N5O/c24-17-6-3-15(4-7-17)1-2-16-5-10-21(29-12-16)23(27,28)22(34,13-33-14-30-31-32-33)19-9-8-18(25)11-20(19)26/h3-12,14,34H,13H2
Standard InChI Key: BPGCIZWBROSBMV-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
3.5824 -2.2658 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.5866 -3.0830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2922 -2.6709 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.8767 -3.4999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1648 -3.0872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8767 -4.3212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3003 -3.4999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1625 -4.7280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1622 -5.5485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8746 -5.9621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5887 -5.5449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5856 -4.7257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1648 -2.2658 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8281 -1.7828 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5756 -1.0015 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7542 -1.0015 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4977 -1.7828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8726 -2.6786 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2978 -4.3223 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0088 -4.7308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7175 -4.3221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7149 -3.4966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0074 -3.0877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4285 -4.7238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1409 -5.1356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8533 -5.5432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8524 -6.3653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5640 -6.7770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2763 -6.3632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2725 -5.5377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5604 -5.1338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4561 -4.3171 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.8756 -6.7792 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.9854 -6.7693 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 2 1 0
4 5 1 0
4 6 1 0
2 7 1 0
6 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 6 1 0
5 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 13 1 0
4 18 1 0
7 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 7 1 0
24 25 3 0
21 24 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
8 32 1 0
10 33 1 0
29 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 471.39Molecular Weight (Monoisotopic): 471.1119AlogP: 3.57#Rotatable Bonds: 5Polar Surface Area: 76.72Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.66CX Basic pKa: 0.32CX LogP: 4.51CX LogD: 4.51Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.36Np Likeness Score: -1.52
References 1. Yates CM, Garvey EP, Shaver SR, Schotzinger RJ, Hoekstra WJ.. (2017) Design and optimization of highly-selective, broad spectrum fungal CYP51 inhibitors., 27 (15): [PMID:28651982 ] [10.1016/j.bmcl.2017.06.037 ] 2. Yates CM, Garvey EP, Shaver SR, Schotzinger RJ, Hoekstra WJ.. (2017) Design and optimization of highly-selective, broad spectrum fungal CYP51 inhibitors., 27 (15): [PMID:28651982 ] [10.1016/j.bmcl.2017.06.037 ] 3. Yates CM, Garvey EP, Shaver SR, Schotzinger RJ, Hoekstra WJ.. (2017) Design and optimization of highly-selective, broad spectrum fungal CYP51 inhibitors., 27 (15): [PMID:28651982 ] [10.1016/j.bmcl.2017.06.037 ]