The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-(((1,4-trans)-4-(3-(3-(Trifluoromethoxy)phenyl)-ureido)cyclohexyl)oxy)-5-(trifluoromethyl)phenyl)acetamide ID: ALA4068373
PubChem CID: 117954773
Max Phase: Preclinical
Molecular Formula: C23H23F6N3O4
Molecular Weight: 519.44
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)Nc1cc(C(F)(F)F)ccc1O[C@H]1CC[C@H](NC(=O)Nc2cccc(OC(F)(F)F)c2)CC1
Standard InChI: InChI=1S/C23H23F6N3O4/c1-13(33)30-19-11-14(22(24,25)26)5-10-20(19)35-17-8-6-15(7-9-17)31-21(34)32-16-3-2-4-18(12-16)36-23(27,28)29/h2-5,10-12,15,17H,6-9H2,1H3,(H,30,33)(H2,31,32,34)/t15-,17-
Standard InChI Key: RUEVHRIRBURBEG-JCNLHEQBSA-N
Molfile:
RDKit 2D
36 38 0 0 0 0 0 0 0 0999 V2000
8.9093 -8.6630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9081 -9.4826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6162 -9.8915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3258 -9.4821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3230 -8.6594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6144 -8.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8311 -8.6837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8299 -9.5032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5380 -9.9122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2476 -9.5027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2448 -8.6801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5362 -8.2748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9510 -8.2688 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6602 -8.6747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3664 -8.2635 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6633 -9.4919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0756 -8.6694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0764 -9.4851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7815 -9.8910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4901 -9.4832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4890 -8.6650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7793 -8.2547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1978 -9.8918 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0292 -8.2482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7384 -8.6541 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.0261 -7.4310 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.7337 -7.8335 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.5378 -10.7293 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8300 -11.1378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8298 -11.9550 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.1224 -10.7290 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.1185 -11.5397 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.6160 -10.7087 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9082 -11.1171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9080 -11.9343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2006 -10.7084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
11 13 1 0
13 14 1 0
14 15 1 0
14 16 2 0
17 15 1 6
17 18 1 0
17 22 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
20 23 1 1
23 2 1 0
5 24 1 0
24 25 1 0
24 26 1 0
24 27 1 0
9 28 1 0
28 29 1 0
29 30 1 0
29 31 1 0
29 32 1 0
3 33 1 0
33 34 1 0
34 35 1 0
34 36 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.44Molecular Weight (Monoisotopic): 519.1593AlogP: 6.07#Rotatable Bonds: 6Polar Surface Area: 88.69Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.36CX Basic pKa: ┄CX LogP: 5.39CX LogD: 5.39Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.40Np Likeness Score: -1.37
References 1. Yefidoff-Freedman R, Fan J, Yan L, Zhang Q, Dos Santos GRR, Rana S, Contreras JI, Sahoo R, Wan D, Young J, Dias Teixeira KL, Morisseau C, Halperin J, Hammock B, Natarajan A, Wang P, Chorev M, Aktas BH.. (2017) Development of 1-((1,4-trans)-4-Aryloxycyclohexyl)-3-arylurea Activators of Heme-Regulated Inhibitor as Selective Activators of the Eukaryotic Initiation Factor 2 Alpha (eIF2α) Phosphorylation Arm of the Integrated Endoplasmic Reticulum Stress Response., 60 (13): [PMID:28590739 ] [10.1021/acs.jmedchem.7b00059 ]