The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(7-((3-Acrylamido-4-methylphenyl)amino)-1-methyl-2-oxo-1,2-dihydropyrimido[4,5-d]pyrimidin-3(4H)-yl)-4-methylphenyl)-2,5-dimethoxybenzamide ID: ALA4068448
PubChem CID: 137631468
Max Phase: Preclinical
Molecular Formula: C33H33N7O5
Molecular Weight: 607.67
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1cc(Nc2ncc3c(n2)N(C)C(=O)N(c2cc(NC(=O)c4cc(OC)ccc4OC)ccc2C)C3)ccc1C
Standard InChI: InChI=1S/C33H33N7O5/c1-7-29(41)37-26-14-22(10-8-19(26)2)36-32-34-17-21-18-40(33(43)39(4)30(21)38-32)27-15-23(11-9-20(27)3)35-31(42)25-16-24(44-5)12-13-28(25)45-6/h7-17H,1,18H2,2-6H3,(H,35,42)(H,37,41)(H,34,36,38)
Standard InChI Key: SQRKDASHRHFNTK-UHFFFAOYSA-N
Molfile:
RDKit 2D
45 49 0 0 0 0 0 0 0 0999 V2000
41.6897 -8.2213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6885 -9.0486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4039 -9.4595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1209 -9.0481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1181 -8.2177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4021 -7.8064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9746 -7.8068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9732 -9.4586 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.8367 -9.4575 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.5511 -9.0459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.2626 -9.4553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.5498 -8.2209 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.2593 -10.2788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.9741 -10.6921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.6895 -10.2764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.6856 -9.4471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.9702 -9.0416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2622 -9.0431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2586 -10.6921 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.9780 -10.2800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5482 -10.2749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5568 -9.4523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8493 -9.0374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1327 -9.4398 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.1280 -10.2655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8362 -10.6809 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.2551 -11.5172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6932 -10.6944 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.4107 -10.6763 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.4063 -11.5013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6863 -11.9040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6816 -12.7282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3949 -13.1474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1145 -12.7322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1158 -11.9093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3916 -13.9724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8288 -13.1482 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.5446 -12.7348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2548 -13.1508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5462 -11.9098 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.2533 -13.9758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.9647 -8.2207 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
46.6727 -7.8055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.9750 -11.5130 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.2645 -11.9243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
2 8 1 0
4 9 1 0
9 10 1 0
10 11 1 0
10 12 2 0
11 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 11 1 0
8 18 1 0
8 20 1 0
18 22 1 0
21 19 1 0
19 20 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
19 27 1 0
20 28 2 0
25 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
33 36 1 0
34 37 1 0
37 38 1 0
38 39 1 0
38 40 2 0
39 41 2 0
17 42 1 0
42 43 1 0
14 44 1 0
44 45 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 607.67Molecular Weight (Monoisotopic): 607.2543AlogP: 5.81#Rotatable Bonds: 9Polar Surface Area: 138.02Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 3#RO5 Violations (Lipinski): 3CX Acidic pKa: 13.10CX Basic pKa: 1.69CX LogP: 5.19CX LogD: 5.19Aromatic Rings: 4Heavy Atoms: 45QED Weighted: 0.20Np Likeness Score: -1.23
References 1. Liang X, Lv F, Wang B, Yu K, Wu H, Qi Z, Jiang Z, Chen C, Wang A, Miao W, Wang W, Hu Z, Liu J, Liu X, Zhao Z, Wang L, Zhang S, Ye Z, Wang C, Ren T, Wang Y, Liu Q, Liu J.. (2017) Discovery of 2-((3-Acrylamido-4-methylphenyl)amino)-N-(2-methyl-5-(3,4,5-trimethoxybenzamido)phenyl)-4-(methylamino)pyrimidine-5-carboxamide (CHMFL-BMX-078) as a Highly Potent and Selective Type II Irreversible Bone Marrow Kinase in the X Chromosome (BMX) Kinase Inhibitor., 60 (5): [PMID:28140585 ] [10.1021/acs.jmedchem.6b01413 ]