The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
sodium-(5S,8S)-5-Isobutyl-3,6,11-trioxo-8-(((S)-2-oxopyrrolidin-3-yl)-methyl)-1-phenyl-2,10-dioxa-4,7-diazahexadecane-9-sulfonate ID: ALA4068460
PubChem CID: 137631811
Max Phase: Preclinical
Molecular Formula: C27H40N3NaO9S
Molecular Weight: 583.70
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCC(=O)OC([C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC(C)C)NC(=O)OCc1ccccc1)S(=O)(=O)[O-].[Na+]
Standard InChI: InChI=1S/C27H41N3O9S.Na/c1-4-5-7-12-23(31)39-26(40(35,36)37)22(16-20-13-14-28-24(20)32)29-25(33)21(15-18(2)3)30-27(34)38-17-19-10-8-6-9-11-19;/h6,8-11,18,20-22,26H,4-5,7,12-17H2,1-3H3,(H,28,32)(H,29,33)(H,30,34)(H,35,36,37);/q;+1/p-1/t20-,21-,22-,26?;/m0./s1
Standard InChI Key: LLFRIYQRGIGTCQ-AZWYUVBXSA-M
Molfile:
RDKit 2D
42 42 0 0 0 0 0 0 0 0999 V2000
21.1855 -10.3904 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.7766 -9.6761 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.3653 -10.3865 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2093 -9.7096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2076 -10.5391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9212 -10.9507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6373 -10.5384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6371 -9.7082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9226 -9.2983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3478 -9.2933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0633 -9.7001 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7781 -9.2852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4916 -9.6994 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7735 -8.4634 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1998 -9.2762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9151 -9.6872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1951 -8.4503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9099 -8.0354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9053 -7.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6253 -8.4463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9198 -10.5090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.6328 -9.2803 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.3522 -9.6842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0670 -9.2693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3568 -10.5102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0723 -10.9212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1631 -11.7356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9730 -11.9156 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.3780 -11.1915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8275 -10.5807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5529 -12.2909 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0624 -8.4475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.7772 -8.0326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7725 -7.2066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.4973 -9.2653 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.4927 -8.4435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2828 -11.1604 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
22.2035 -8.0311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9162 -8.4404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6269 -8.0280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3395 -8.4373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5730 -9.5853 0.0000 Na 0 0 0 0 0 15 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
13 15 1 0
15 16 1 0
15 17 1 1
17 18 1 0
18 19 1 0
18 20 1 0
16 21 2 0
16 22 1 0
22 23 1 0
23 24 1 0
23 25 1 6
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
26 30 1 0
27 31 2 0
24 2 1 0
24 32 1 0
32 33 1 0
33 34 2 0
2 35 1 0
33 36 1 0
26 37 1 1
36 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
M CHG 2 35 -1 42 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 583.70Molecular Weight (Monoisotopic): 583.2564AlogP: 2.68#Rotatable Bonds: 16Polar Surface Area: 177.20Molecular Species: ACIDHBA: 8HBD: 4#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: -0.78CX Basic pKa: ┄CX LogP: 2.05CX LogD: 0.63Aromatic Rings: 1Heavy Atoms: 40QED Weighted: 0.13Np Likeness Score: 0.28
References 1. Galasiti Kankanamalage AC, Kim Y, Rathnayake AD, Alliston KR, Butler MM, Cardinale SC, Bowlin TL, Groutas WC, Chang KO.. (2017) Design, Synthesis, and Evaluation of Novel Prodrugs of Transition State Inhibitors of Norovirus 3CL Protease., 60 (14): [PMID:28671827 ] [10.1021/acs.jmedchem.7b00497 ]