The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R,3R,4R,5R)-2-(acetoxymethyl)-5-(4-((N-butylmethylsulfonamido)methyl)-1H-1,2,3-triazol-1-yl)tetrahydrofuran-3,4-diyl diacetate ID: ALA4068912
PubChem CID: 137633510
Max Phase: Preclinical
Molecular Formula: C19H30N4O9S
Molecular Weight: 490.54
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCN(Cc1cn([C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H]2OC(C)=O)nn1)S(C)(=O)=O
Standard InChI: InChI=1S/C19H30N4O9S/c1-6-7-8-22(33(5,27)28)9-15-10-23(21-20-15)19-18(31-14(4)26)17(30-13(3)25)16(32-19)11-29-12(2)24/h10,16-19H,6-9,11H2,1-5H3/t16-,17-,18-,19-/m1/s1
Standard InChI Key: OUJIYPLOPOSPKT-NCXUSEDFSA-N
Molfile:
RDKit 2D
33 34 0 0 0 0 0 0 0 0999 V2000
15.3582 -4.9125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9499 -5.6291 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.7747 -5.6244 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5666 -6.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3916 -6.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6483 -5.9242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9791 -5.4374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3140 -5.9242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4333 -5.6703 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8756 -7.3764 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0808 -7.3751 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5293 -5.6696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9165 -6.2219 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1317 -5.9673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5188 -6.5197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9598 -5.1604 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4153 -8.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9295 -8.7960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2357 -8.2165 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6963 -7.2910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1804 -7.9591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0327 -6.5377 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1023 -6.1528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7705 -5.6688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5166 -4.8838 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6917 -4.8828 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.5548 -5.9248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1686 -5.3736 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9982 -4.5665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1232 -6.4369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2140 -4.3105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0435 -3.5032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2592 -3.2472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 4 1 0
6 9 1 1
5 10 1 6
4 11 1 6
8 12 1 1
12 13 1 0
13 14 1 0
14 15 1 0
14 16 2 0
11 17 1 0
17 18 1 0
17 19 2 0
10 20 1 0
20 21 1 0
20 22 2 0
9 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 9 1 0
24 27 1 0
27 28 1 0
28 2 1 0
28 29 1 0
2 30 1 0
29 31 1 0
31 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 490.54Molecular Weight (Monoisotopic): 490.1733AlogP: 0.16#Rotatable Bonds: 11Polar Surface Area: 156.22Molecular Species: NEUTRALHBA: 12HBD: ┄#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: -0.37CX LogD: -0.37Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.31Np Likeness Score: -0.19
References 1. Alaoui S, Dufies M, Driowya M, Demange L, Bougrin K, Robert G, Auberger P, Pagès G, Benhida R.. (2017) Synthesis and anti-cancer activities of new sulfonamides 4-substituted-triazolyl nucleosides., 27 (9): [PMID:28325600 ] [10.1016/j.bmcl.2017.03.018 ]