The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[{1-(tert-Butyl)-5-(4-piperidin-1-yl-phenyl)-1H-pyrazol-3-yl}methyl]-2,3-dihydrobenzo[d]isothiazole 1,1-dioxide ID: ALA4069336
PubChem CID: 137634068
Max Phase: Preclinical
Molecular Formula: C26H32N4O2S
Molecular Weight: 464.64
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)n1nc(CN2Cc3ccccc3S2(=O)=O)cc1-c1ccc(C2CCNCC2)cc1
Standard InChI: InChI=1S/C26H32N4O2S/c1-26(2,3)30-24(21-10-8-19(9-11-21)20-12-14-27-15-13-20)16-23(28-30)18-29-17-22-6-4-5-7-25(22)33(29,31)32/h4-11,16,20,27H,12-15,17-18H2,1-3H3
Standard InChI Key: AOPHJLXVCLRNSP-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
14.6145 -9.0964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7973 -9.0964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2059 -9.8041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6281 -5.6955 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.1070 -6.3585 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6215 -7.0137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8463 -6.7569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8530 -5.9397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1472 -5.5295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4348 -5.9323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4323 -6.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1380 -7.1638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9241 -6.3610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8052 -8.2841 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1440 -7.7985 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4001 -7.0266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2186 -7.0266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4665 -7.8045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1819 -8.1976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8798 -7.7757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6002 -8.1691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6144 -8.9838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9162 -9.4098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2000 -9.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3405 -5.2885 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2998 -4.9455 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0907 -9.5035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3302 -9.3770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3453 -10.1950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0573 -10.5888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7588 -10.1689 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7437 -9.3509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0271 -8.9528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
4 8 1 0
9 10 1 0
10 11 2 0
11 12 1 0
7 12 2 0
8 9 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
14 18 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
19 24 2 0
18 19 1 0
14 2 1 0
13 16 1 0
5 13 1 0
4 25 2 0
4 26 2 0
2 27 1 0
28 29 1 0
28 33 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
22 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.64Molecular Weight (Monoisotopic): 464.2246AlogP: 4.48#Rotatable Bonds: 4Polar Surface Area: 67.23Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.92CX Basic pKa: 10.06CX LogP: 3.64CX LogD: 1.18Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.62Np Likeness Score: -0.74
References 1. Hong JR, Choi YJ, Keum G, Nam G.. (2017) Synthesis and diabetic neuropathic pain-alleviating effects of 2N-(pyrazol-3-yl)methylbenzo[d]isothiazole-1,1-dioxide derivatives., 25 (17): [PMID:28720324 ] [10.1016/j.bmc.2017.07.008 ]