(E)-6-ethyl-7-(4-(3-(4-isopropylpiperazin-1-yl)prop-1-en-1-yl)benzyl)-2,4-dimethyl-7H-pyrrolo[2,3-d]pyrimidine

ID: ALA4069664

PubChem CID: 137638292

Max Phase: Preclinical

Molecular Formula: C27H37N5

Molecular Weight: 431.63

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCc1cc2c(C)nc(C)nc2n1Cc1ccc(/C=C/CN2CCN(C(C)C)CC2)cc1

Standard InChI:  InChI=1S/C27H37N5/c1-6-25-18-26-21(4)28-22(5)29-27(26)32(25)19-24-11-9-23(10-12-24)8-7-13-30-14-16-31(17-15-30)20(2)3/h7-12,18,20H,6,13-17,19H2,1-5H3/b8-7+

Standard InChI Key:  RFUAZLCQZXGAQP-BQYQJAHWSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    4.0237  -11.8572    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7343  -11.4465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4432  -11.8530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4435  -12.6717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1557  -13.0822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8673  -12.6673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8622  -11.8418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1494  -11.4391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5788  -13.0733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2844  -12.6612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9942  -13.0663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6998  -12.6541    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4089  -13.0621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1125  -12.6535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1126  -11.8359    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4030  -11.4287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6933  -11.8390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8198  -11.4265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5280  -11.8342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8188  -10.6093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2758  -11.5293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7269  -12.1395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9403  -12.6790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1408  -12.8459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8870  -13.6204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4319  -14.2286    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2337  -14.0572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4837  -13.2830    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0873  -13.7883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7814  -14.6637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1035  -10.7305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7091  -10.1818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  6  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 12 17  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 15 18  1  0
 18 19  1  0
 18 20  1  0
  1 21  1  0
 21 22  2  0
 22 24  1  0
 23  1  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 25 29  1  0
 27 30  1  0
 21 31  1  0
 31 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4069664

    ---

Associated Targets(Human)

GPR4 Tchem G-protein coupled receptor 4 (124 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Gpr4 G-protein coupled receptor 4 (14 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Gpr4 G-protein coupled receptor 4 (12 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 431.63Molecular Weight (Monoisotopic): 431.3049AlogP: 4.70#Rotatable Bonds: 7
Polar Surface Area: 37.19Molecular Species: BASEHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.51CX LogP: 5.07CX LogD: 3.90
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.54Np Likeness Score: -1.35

References

1. Miltz W, Velcicky J, Dawson J, Littlewood-Evans A, Ludwig MG, Seuwen K, Feifel R, Oberhauser B, Meyer A, Gabriel D, Nash M, Loetscher P..  (2017)  Design and synthesis of potent and orally active GPR4 antagonists with modulatory effects on nociception, inflammation, and angiogenesis.,  25  (16): [PMID:28689977] [10.1016/j.bmc.2017.06.050]

Source