The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-6-ethyl-7-(4-(3-(4-isopropylpiperazin-1-yl)prop-1-en-1-yl)benzyl)-2,4-dimethyl-7H-pyrrolo[2,3-d]pyrimidine ID: ALA4069664
PubChem CID: 137638292
Max Phase: Preclinical
Molecular Formula: C27H37N5
Molecular Weight: 431.63
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCc1cc2c(C)nc(C)nc2n1Cc1ccc(/C=C/CN2CCN(C(C)C)CC2)cc1
Standard InChI: InChI=1S/C27H37N5/c1-6-25-18-26-21(4)28-22(5)29-27(26)32(25)19-24-11-9-23(10-12-24)8-7-13-30-14-16-31(17-15-30)20(2)3/h7-12,18,20H,6,13-17,19H2,1-5H3/b8-7+
Standard InChI Key: RFUAZLCQZXGAQP-BQYQJAHWSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
4.0237 -11.8572 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7343 -11.4465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4432 -11.8530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4435 -12.6717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1557 -13.0822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8673 -12.6673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8622 -11.8418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1494 -11.4391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5788 -13.0733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2844 -12.6612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9942 -13.0663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6998 -12.6541 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4089 -13.0621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1125 -12.6535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1126 -11.8359 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4030 -11.4287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6933 -11.8390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8198 -11.4265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5280 -11.8342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8188 -10.6093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2758 -11.5293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7269 -12.1395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9403 -12.6790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1408 -12.8459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8870 -13.6204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4319 -14.2286 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2337 -14.0572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4837 -13.2830 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0873 -13.7883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7814 -14.6637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1035 -10.7305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7091 -10.1818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
6 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
12 13 1 0
12 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
15 18 1 0
18 19 1 0
18 20 1 0
1 21 1 0
21 22 2 0
22 24 1 0
23 1 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
25 29 1 0
27 30 1 0
21 31 1 0
31 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.63Molecular Weight (Monoisotopic): 431.3049AlogP: 4.70#Rotatable Bonds: 7Polar Surface Area: 37.19Molecular Species: BASEHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.51CX LogP: 5.07CX LogD: 3.90Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.54Np Likeness Score: -1.35
References 1. Miltz W, Velcicky J, Dawson J, Littlewood-Evans A, Ludwig MG, Seuwen K, Feifel R, Oberhauser B, Meyer A, Gabriel D, Nash M, Loetscher P.. (2017) Design and synthesis of potent and orally active GPR4 antagonists with modulatory effects on nociception, inflammation, and angiogenesis., 25 (16): [PMID:28689977 ] [10.1016/j.bmc.2017.06.050 ]