(2S)-benzyl 2-((((R)-2-amino-2-methyl-3-((4-(4-(p-tolyl)butanoyl)benzyl)oxy)propoxy)(phenoxy)phosphoryl)amino)propanoate

ID: ALA4069697

PubChem CID: 137639194

Max Phase: Preclinical

Molecular Formula: C38H45N2O7P

Molecular Weight: 672.76

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(CCCC(=O)c2ccc(COC[C@@](C)(N)COP(=O)(N[C@@H](C)C(=O)OCc3ccccc3)Oc3ccccc3)cc2)cc1

Standard InChI:  InChI=1S/C38H45N2O7P/c1-29-17-19-31(20-18-29)13-10-16-36(41)34-23-21-33(22-24-34)25-44-27-38(3,39)28-46-48(43,47-35-14-8-5-9-15-35)40-30(2)37(42)45-26-32-11-6-4-7-12-32/h4-9,11-12,14-15,17-24,30H,10,13,16,25-28,39H2,1-3H3,(H,40,43)/t30-,38+,48?/m0/s1

Standard InChI Key:  ULYWBKFVIGPTLU-ZVAFOHNYSA-N

Molfile:  

     RDKit          2D

 48 51  0  0  0  0  0  0  0  0999 V2000
   22.9128  -11.9463    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.5526  -12.4566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6692  -13.5706    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.3169  -12.1559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4335  -13.2699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0733  -13.7802    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.9515  -14.5882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8037  -11.4530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8026  -12.2726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5106  -12.6815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2203  -12.2721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2175  -11.4494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5088  -11.0442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9286  -12.6796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9299  -13.4968    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.6357  -12.2699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3440  -12.6773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0511  -12.2676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7595  -12.6751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0959  -11.0446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3883  -11.4534    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.6805  -11.0449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9729  -11.4537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2651  -11.0453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9656  -10.6359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5575  -11.4540    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.8497  -11.0456    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   22.1421  -11.4544    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.8495  -10.2284    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.7563  -13.4930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4639  -13.9004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1719  -13.4906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1680  -12.6692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4599  -12.2655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8808  -13.8972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4342  -11.0459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4384  -10.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7314   -9.8208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0228  -10.2296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0256  -11.0511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7332  -11.4557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1756  -12.2709    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.5904  -15.0978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4654  -15.9061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1035  -16.4154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8651  -16.1170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9850  -15.3043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3458  -14.7986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  6  1  0
  1  2  1  0
  2  5  1  0
  5  3  2  0
  2  4  1  1
  6  7  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 11 14  1  0
 14 15  2  0
 14 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
  8 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  1
 23 25  1  0
 24 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  2  0
 27  1  1  0
 19 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 19  1  0
 32 35  1  0
 28 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41 36  1  0
 23 42  1  0
  7 43  1  0
 43 44  2  0
 44 45  1  0
 45 46  2  0
 46 47  1  0
 47 48  2  0
 48 43  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4069697

    ---

Associated Targets(Human)

Serum (1292 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 672.76Molecular Weight (Monoisotopic): 672.2964AlogP: 7.36#Rotatable Bonds: 19
Polar Surface Area: 126.18Molecular Species: BASEHBA: 8HBD: 2
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 10.33CX Basic pKa: 9.49CX LogP: 6.68CX LogD: 4.86
Aromatic Rings: 4Heavy Atoms: 48QED Weighted: 0.06Np Likeness Score: -0.29

References

1. James E, Pertusati F, Brancale A, McGuigan C..  (2017)  Kinase-independent phosphoramidate S1P1 receptor agonist benzyl ether derivatives.,  27  (6): [PMID:28236593] [10.1016/j.bmcl.2017.02.011]

Source