The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S)-benzyl 2-((((R)-2-amino-2-methyl-3-((4-(4-(p-tolyl)butanoyl)benzyl)oxy)propoxy)(phenoxy)phosphoryl)amino)propanoate ID: ALA4069697
PubChem CID: 137639194
Max Phase: Preclinical
Molecular Formula: C38H45N2O7P
Molecular Weight: 672.76
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(CCCC(=O)c2ccc(COC[C@@](C)(N)COP(=O)(N[C@@H](C)C(=O)OCc3ccccc3)Oc3ccccc3)cc2)cc1
Standard InChI: InChI=1S/C38H45N2O7P/c1-29-17-19-31(20-18-29)13-10-16-36(41)34-23-21-33(22-24-34)25-44-27-38(3,39)28-46-48(43,47-35-14-8-5-9-15-35)40-30(2)37(42)45-26-32-11-6-4-7-12-32/h4-9,11-12,14-15,17-24,30H,10,13,16,25-28,39H2,1-3H3,(H,40,43)/t30-,38+,48?/m0/s1
Standard InChI Key: ULYWBKFVIGPTLU-ZVAFOHNYSA-N
Molfile:
RDKit 2D
48 51 0 0 0 0 0 0 0 0999 V2000
22.9128 -11.9463 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.5526 -12.4566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6692 -13.5706 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.3169 -12.1559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4335 -13.2699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0733 -13.7802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.9515 -14.5882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8037 -11.4530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8026 -12.2726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5106 -12.6815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2203 -12.2721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2175 -11.4494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5088 -11.0442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9286 -12.6796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9299 -13.4968 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.6357 -12.2699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3440 -12.6773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0511 -12.2676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7595 -12.6751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0959 -11.0446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3883 -11.4534 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.6805 -11.0449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9729 -11.4537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2651 -11.0453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9656 -10.6359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5575 -11.4540 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.8497 -11.0456 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
22.1421 -11.4544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.8495 -10.2284 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.7563 -13.4930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4639 -13.9004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1719 -13.4906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1680 -12.6692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4599 -12.2655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8808 -13.8972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4342 -11.0459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4384 -10.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7314 -9.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0228 -10.2296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0256 -11.0511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7332 -11.4557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1756 -12.2709 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.5904 -15.0978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4654 -15.9061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1035 -16.4154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8651 -16.1170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9850 -15.3043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3458 -14.7986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 6 1 0
1 2 1 0
2 5 1 0
5 3 2 0
2 4 1 1
6 7 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
11 14 1 0
14 15 2 0
14 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
8 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 1
23 25 1 0
24 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
27 1 1 0
19 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 19 1 0
32 35 1 0
28 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
23 42 1 0
7 43 1 0
43 44 2 0
44 45 1 0
45 46 2 0
46 47 1 0
47 48 2 0
48 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 672.76Molecular Weight (Monoisotopic): 672.2964AlogP: 7.36#Rotatable Bonds: 19Polar Surface Area: 126.18Molecular Species: BASEHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.33CX Basic pKa: 9.49CX LogP: 6.68CX LogD: 4.86Aromatic Rings: 4Heavy Atoms: 48QED Weighted: 0.06Np Likeness Score: -0.29
References 1. James E, Pertusati F, Brancale A, McGuigan C.. (2017) Kinase-independent phosphoramidate S1P1 receptor agonist benzyl ether derivatives., 27 (6): [PMID:28236593 ] [10.1016/j.bmcl.2017.02.011 ]