The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((4-((6-(2-(2,4-difluorophenyl)-1,1-difluoro-2-hydroxy-3-(1H-tetrazol-1-yl)propyl)pyridin-3-yl)ethynyl)phenoxy)methyl)-N-methylbenzamide ID: ALA4069838
PubChem CID: 89619702
Max Phase: Preclinical
Molecular Formula: C32H24F4N6O3
Molecular Weight: 616.58
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)c1ccc(COc2ccc(C#Cc3ccc(C(F)(F)C(O)(Cn4cnnn4)c4ccc(F)cc4F)nc3)cc2)cc1
Standard InChI: InChI=1S/C32H24F4N6O3/c1-37-30(43)24-9-4-23(5-10-24)18-45-26-12-6-21(7-13-26)2-3-22-8-15-29(38-17-22)32(35,36)31(44,19-42-20-39-40-41-42)27-14-11-25(33)16-28(27)34/h4-17,20,44H,18-19H2,1H3,(H,37,43)
Standard InChI Key: LLWANKSWBQUOSR-UHFFFAOYSA-N
Molfile:
RDKit 2D
45 49 0 0 0 0 0 0 0 0999 V2000
3.2481 -24.7592 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.2523 -25.5764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9579 -25.1643 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.5424 -25.9933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8305 -25.5806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5424 -26.8146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9660 -25.9933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8282 -27.2213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8279 -28.0419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5403 -28.4554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2544 -28.0383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2513 -27.2191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8305 -24.7592 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4938 -24.2762 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2413 -23.4949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4199 -23.4949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1634 -24.2762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5382 -25.1720 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9635 -26.8157 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6745 -27.2242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3832 -26.8155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3806 -25.9900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6731 -25.5810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0942 -27.2172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8066 -27.6290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5190 -28.0366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5181 -28.8587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2297 -29.2704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9420 -28.8566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9382 -28.0311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2261 -27.6272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1218 -26.8105 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.5413 -29.2726 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.6511 -29.2627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3574 -28.8516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0665 -29.2577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0653 -30.0721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7736 -30.4781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4808 -30.0669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4752 -29.2455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7664 -28.8432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1905 -30.4720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1945 -31.2892 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8962 -30.0600 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.6059 -30.4651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 2 1 0
4 5 1 0
4 6 1 0
2 7 1 0
6 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 6 1 0
5 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 13 1 0
4 18 1 0
7 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 7 1 0
24 25 3 0
21 24 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
8 32 1 0
10 33 1 0
29 34 1 0
34 35 1 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
39 42 1 0
42 43 2 0
42 44 1 0
44 45 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 616.58Molecular Weight (Monoisotopic): 616.1846AlogP: 4.36#Rotatable Bonds: 9Polar Surface Area: 115.05Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.66CX Basic pKa: 0.35CX LogP: 5.01CX LogD: 5.01Aromatic Rings: 5Heavy Atoms: 45QED Weighted: 0.19Np Likeness Score: -1.43
References 1. Yates CM, Garvey EP, Shaver SR, Schotzinger RJ, Hoekstra WJ.. (2017) Design and optimization of highly-selective, broad spectrum fungal CYP51 inhibitors., 27 (15): [PMID:28651982 ] [10.1016/j.bmcl.2017.06.037 ]