The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-6-amino-2-(4-((S)-3-(((R)-1-(naphthalen-1-yl)ethyl)amino)pyrrolidin-1-yl)benzamido)hexanoic acid ID: ALA4070562
PubChem CID: 137638922
Max Phase: Preclinical
Molecular Formula: C29H36N4O3
Molecular Weight: 488.63
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H](N[C@H]1CCN(c2ccc(C(=O)N[C@H](CCCCN)C(=O)O)cc2)C1)c1cccc2ccccc12
Standard InChI: InChI=1S/C29H36N4O3/c1-20(25-10-6-8-21-7-2-3-9-26(21)25)31-23-16-18-33(19-23)24-14-12-22(13-15-24)28(34)32-27(29(35)36)11-4-5-17-30/h2-3,6-10,12-15,20,23,27,31H,4-5,11,16-19,30H2,1H3,(H,32,34)(H,35,36)/t20-,23+,27-/m1/s1
Standard InChI Key: VMHMNFDZZDGSOC-PCGJDWNTSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
15.3007 -5.9836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4321 -5.1043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4310 -5.9318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8595 -5.1007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1440 -4.6916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8623 -5.9313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1450 -6.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1435 -7.1673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8585 -7.5821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5765 -7.1658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5745 -6.3423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2885 -5.9289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0035 -6.3405 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2874 -5.1038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7175 -5.9270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4720 -6.2596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0233 -5.6458 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6098 -4.9318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8031 -5.1045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8439 -5.7310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1762 -6.4857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9960 -6.5711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4810 -5.9025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1402 -5.1464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3214 -5.0646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6392 -6.7395 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1560 -7.4082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7827 -5.3141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4936 -8.1610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0104 -8.8297 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3353 -7.3241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8521 -7.9928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0314 -7.9087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5482 -8.5774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7274 -8.4933 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.3143 -8.2451 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 7 1 0
6 4 1 0
4 5 2 0
5 2 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 6 2 0
11 12 1 0
12 13 1 0
12 14 1 1
15 13 1 1
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 15 1 0
17 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
23 1 1 0
1 26 1 0
26 27 1 0
1 28 2 0
27 29 1 1
29 30 1 0
27 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
29 36 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 488.63Molecular Weight (Monoisotopic): 488.2787AlogP: 4.08#Rotatable Bonds: 11Polar Surface Area: 107.69Molecular Species: ZWITTERIONHBA: 5HBD: 4#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.35CX Basic pKa: 10.28CX LogP: 1.26CX LogD: -0.47Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.30Np Likeness Score: -0.69
References 1. Sparks SM, Spearing PK, Diaz CJ, Cowan DJ, Jayawickreme C, Chen G, Rimele TJ, Generaux C, Harston LT, Roller SG.. (2017) Identification of potent, nonabsorbable agonists of the calcium-sensing receptor for GI-specific administration., 27 (20): [PMID:28916340 ] [10.1016/j.bmcl.2017.09.008 ]