The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4070676
PubChem CID: 137639713
Max Phase: Preclinical
Molecular Formula: C24H28N2O7
Molecular Weight: 456.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@]12C[C@@]34C=CC(=O)[C@@](C)(CCNC(=O)Nc5c(O)ccc(C(=O)O)c5O)[C@@H]3[C@H](C[C@@H]1C4)O2
Standard InChI: InChI=1S/C24H28N2O7/c1-22(7-8-25-21(32)26-17-14(27)4-3-13(18(17)29)20(30)31)16(28)5-6-24-10-12-9-15(19(22)24)33-23(12,2)11-24/h3-6,12,15,19,27,29H,7-11H2,1-2H3,(H,30,31)(H2,25,26,32)/t12-,15+,19+,22-,23+,24+/m1/s1
Standard InChI Key: LRKHAPWRPPSILY-BCXVYZDJSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
9.6252 -8.3392 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3477 -8.7777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0928 -8.3718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8151 -8.8104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8363 -7.9643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5620 -8.4028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2888 -8.8433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3340 -9.8479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5428 -9.4374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3014 -10.2507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4880 -10.0093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7218 -10.2122 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3928 -9.5139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7749 -9.7967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0930 -8.7132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5380 -9.1021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5551 -8.2540 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12.1777 -8.9383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0670 -10.7432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5807 -7.5564 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9029 -8.7401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2004 -8.3102 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8873 -9.5625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4780 -8.7111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7763 -8.2799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0548 -8.6756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0385 -9.5036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7484 -9.9290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4657 -9.5297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7959 -7.4575 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1714 -9.9503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7329 -10.7516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0126 -11.1522 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4420 -11.1737 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9922 -10.6129 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 1
4 6 1 0
6 7 1 0
8 7 2 0
9 8 1 0
9 10 1 0
10 11 1 0
11 12 1 6
12 13 1 0
14 13 1 0
4 14 1 0
14 9 1 0
13 15 1 1
16 15 1 0
16 17 1 1
16 11 1 0
18 16 1 0
9 18 1 1
11 19 1 0
6 20 2 0
1 21 1 0
21 22 1 0
21 23 2 0
22 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
25 30 1 0
29 31 1 0
28 32 1 0
32 33 2 0
32 34 1 0
14 35 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.50Molecular Weight (Monoisotopic): 456.1897AlogP: 3.03#Rotatable Bonds: 5Polar Surface Area: 145.19Molecular Species: ACIDHBA: 6HBD: 5#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 2.95CX Basic pKa: ┄CX LogP: 2.86CX LogD: -0.63Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.43Np Likeness Score: 2.29
References 1. Dong LB, Rudolf JD, Lin L, Ruiz C, Cameron MD, Shen B.. (2017) In vivo instability of platensimycin and platencin: Synthesis and biological evaluation of urea- and carbamate-platensimycin., 25 (6): [PMID:28237556 ] [10.1016/j.bmc.2017.02.028 ]