The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3-(4-cyclohexylphenyl)-2-(4-(2-(dimethylamino)ethyl)piperazin-1-yl)-3,4-dihydroquinazolin-4-yl)-N-(4-fluorobenzyl)acetamide ID: ALA4070816
PubChem CID: 137638499
Max Phase: Preclinical
Molecular Formula: C37H47FN6O
Molecular Weight: 610.82
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)CCN1CCN(C2=Nc3ccccc3C(CC(=O)NCc3ccc(F)cc3)N2c2ccc(C3CCCCC3)cc2)CC1
Standard InChI: InChI=1S/C37H47FN6O/c1-41(2)20-21-42-22-24-43(25-23-42)37-40-34-11-7-6-10-33(34)35(26-36(45)39-27-28-12-16-31(38)17-13-28)44(37)32-18-14-30(15-19-32)29-8-4-3-5-9-29/h6-7,10-19,29,35H,3-5,8-9,20-27H2,1-2H3,(H,39,45)
Standard InChI Key: FCAZYNLURSNZQE-UHFFFAOYSA-N
Molfile:
RDKit 2D
45 50 0 0 0 0 0 0 0 0999 V2000
4.8935 -13.5208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8923 -14.3403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6004 -14.7493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5986 -13.1119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3072 -13.5172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3061 -14.3378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0122 -14.7469 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7241 -14.3398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7253 -13.5192 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0146 -13.1056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4307 -14.7504 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4340 -13.1123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0146 -12.2884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3069 -11.8798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3069 -11.0626 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5992 -12.2884 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8915 -11.8797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1391 -13.5272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8473 -13.1210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8498 -12.3030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1381 -11.8928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4328 -12.3014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5579 -11.8951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2641 -12.3076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9717 -11.9005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9731 -11.0824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2608 -10.6732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5561 -11.0827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8915 -11.0626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6005 -10.6572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6008 -9.8408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8926 -9.4314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1826 -9.8443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1857 -10.6594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8915 -8.6142 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.4233 -15.5643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1258 -15.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8370 -15.5717 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8413 -14.7536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1343 -14.3385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5420 -15.9849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5367 -16.8021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2417 -17.2153 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9907 -16.8843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1951 -18.0312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
8 11 1 0
9 12 1 0
10 13 1 0
13 14 1 0
14 15 2 0
14 16 1 0
16 17 1 0
12 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 12 1 0
20 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 23 1 0
17 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
32 35 1 0
11 36 1 0
11 40 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
38 41 1 0
41 42 1 0
42 43 1 0
44 43 1 0
43 45 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 610.82Molecular Weight (Monoisotopic): 610.3795AlogP: 6.31#Rotatable Bonds: 9Polar Surface Area: 54.42Molecular Species: BASEHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.02CX LogP: 6.13CX LogD: 3.72Aromatic Rings: 3Heavy Atoms: 45QED Weighted: 0.31Np Likeness Score: -1.10
References 1. Kim JH, Jeong HR, Jung DW, Yoon HB, Kim SY, Kim HJ, Lee KT, Gadotti VM, Huang J, Zhang FX, Zamponi GW, Lee JY.. (2017) Synthesis and biological evaluation of fluoro-substituted 3,4-dihydroquinazoline derivatives for cytotoxic and analgesic effects., 25 (17): [PMID:28720332 ] [10.1016/j.bmc.2017.07.010 ]