(S)-4-benzyl-1-(4-((S)-2-(3-methoxybenzyl)-4,5-dihydro-1H-imidazol-4-yl)butyl)-3-phenethylimidazolidine-2-thione

ID: ALA4071074

PubChem CID: 137639957

Max Phase: Preclinical

Molecular Formula: C33H40N4OS

Molecular Weight: 540.78

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc(CC2=N[C@@H](CCCCN3C[C@H](Cc4ccccc4)N(CCc4ccccc4)C3=S)CN2)c1

Standard InChI:  InChI=1S/C33H40N4OS/c1-38-31-17-10-15-28(22-31)23-32-34-24-29(35-32)16-8-9-19-36-25-30(21-27-13-6-3-7-14-27)37(33(36)39)20-18-26-11-4-2-5-12-26/h2-7,10-15,17,22,29-30H,8-9,16,18-21,23-25H2,1H3,(H,34,35)/t29-,30-/m0/s1

Standard InChI Key:  JKGHACQJEXDNDH-KYJUHHDHSA-N

Molfile:  

     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
    6.5329   -7.9491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3492   -7.9125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5685   -7.1251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8845   -6.6732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2481   -7.1844    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1373   -8.6639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3340   -6.8390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9645   -7.3589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7299   -7.0728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3604   -7.5927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1259   -7.3066    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.8060   -7.7582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4456   -7.2496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1594   -6.4841    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3431   -6.5197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8339   -5.8805    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.2330   -7.4681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3700   -8.2739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7405   -8.7902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8770   -9.5952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6438   -9.8801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2746   -9.3539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1349   -8.5509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6105   -5.8026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4262   -5.8525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8368   -5.1460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6530   -5.1499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0635   -4.4442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6569   -3.7344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8354   -3.7347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4286   -4.4410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5586   -9.3641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1613  -10.0754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5819  -10.7751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3999  -10.7608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7953  -10.0408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3724   -9.3440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1876  -11.4847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6086  -12.1851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  1  6  1  0
  3  7  1  6
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 15 16  2  0
 13 17  1  1
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 14 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
  6 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 38 39  1  0
 34 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4071074

    ---

Associated Targets(Human)

RORA Tchem Nuclear receptor ROR-alpha (562 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rorb Nuclear receptor ROR-beta (15 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Rorc Nuclear receptor ROR-gamma (89407 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 540.78Molecular Weight (Monoisotopic): 540.2923AlogP: 5.53#Rotatable Bonds: 13
Polar Surface Area: 40.10Molecular Species: BASEHBA: 4HBD: 1
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 9.82CX LogP: 6.29CX LogD: 4.17
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.23Np Likeness Score: -0.24

References

1. Nefzi A, Marconi GD, Ortiz MA, Davis JC, Piedrafita FJ..  (2017)  Synthesis of dihydroimidazole tethered imidazolinethiones and their activity as novel antagonists of the nuclear retinoic acid receptor-related orphan receptors (RORs).,  27  (7): [PMID:28242276] [10.1016/j.bmcl.2017.02.014]

Source