The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-4-benzyl-1-(4-((S)-2-(3-methoxybenzyl)-4,5-dihydro-1H-imidazol-4-yl)butyl)-3-phenethylimidazolidine-2-thione ID: ALA4071074
PubChem CID: 137639957
Max Phase: Preclinical
Molecular Formula: C33H40N4OS
Molecular Weight: 540.78
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(CC2=N[C@@H](CCCCN3C[C@H](Cc4ccccc4)N(CCc4ccccc4)C3=S)CN2)c1
Standard InChI: InChI=1S/C33H40N4OS/c1-38-31-17-10-15-28(22-31)23-32-34-24-29(35-32)16-8-9-19-36-25-30(21-27-13-6-3-7-14-27)37(33(36)39)20-18-26-11-4-2-5-12-26/h2-7,10-15,17,22,29-30H,8-9,16,18-21,23-25H2,1H3,(H,34,35)/t29-,30-/m0/s1
Standard InChI Key: JKGHACQJEXDNDH-KYJUHHDHSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
6.5329 -7.9491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3492 -7.9125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5685 -7.1251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8845 -6.6732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2481 -7.1844 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1373 -8.6639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3340 -6.8390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9645 -7.3589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7299 -7.0728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3604 -7.5927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1259 -7.3066 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8060 -7.7582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4456 -7.2496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1594 -6.4841 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3431 -6.5197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8339 -5.8805 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.2330 -7.4681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3700 -8.2739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7405 -8.7902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8770 -9.5952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6438 -9.8801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2746 -9.3539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1349 -8.5509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6105 -5.8026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4262 -5.8525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8368 -5.1460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6530 -5.1499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0635 -4.4442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6569 -3.7344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8354 -3.7347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4286 -4.4410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5586 -9.3641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1613 -10.0754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5819 -10.7751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3999 -10.7608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7953 -10.0408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3724 -9.3440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1876 -11.4847 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6086 -12.1851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
1 6 1 0
3 7 1 6
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 11 1 0
15 16 2 0
13 17 1 1
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
14 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
6 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
38 39 1 0
34 38 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 540.78Molecular Weight (Monoisotopic): 540.2923AlogP: 5.53#Rotatable Bonds: 13Polar Surface Area: 40.10Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.82CX LogP: 6.29CX LogD: 4.17Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.23Np Likeness Score: -0.24
References 1. Nefzi A, Marconi GD, Ortiz MA, Davis JC, Piedrafita FJ.. (2017) Synthesis of dihydroimidazole tethered imidazolinethiones and their activity as novel antagonists of the nuclear retinoic acid receptor-related orphan receptors (RORs)., 27 (7): [PMID:28242276 ] [10.1016/j.bmcl.2017.02.014 ]