The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-(4-(6-(3-(3-Aminopyrrolidin-1-yl)propoxy)benzo[d]oxazol-2-yl)phenoxy)propyl)pyrrolidin-3-amine ID: ALA4071152
PubChem CID: 137640101
Max Phase: Preclinical
Molecular Formula: C27H37N5O3
Molecular Weight: 479.63
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: NC1CCN(CCCOc2ccc(-c3nc4ccc(OCCCN5CCC(N)C5)cc4o3)cc2)C1
Standard InChI: InChI=1S/C27H37N5O3/c28-21-9-13-31(18-21)11-1-15-33-23-5-3-20(4-6-23)27-30-25-8-7-24(17-26(25)35-27)34-16-2-12-32-14-10-22(29)19-32/h3-8,17,21-22H,1-2,9-16,18-19,28-29H2
Standard InChI Key: BIAMYZCEEUPXLJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
17.1571 -13.2166 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9044 -12.8823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4563 -13.4893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0436 -14.2041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2411 -14.0364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2709 -13.4082 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.4480 -12.8038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7348 -13.2166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7348 -14.0338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0257 -14.4465 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3166 -14.0338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6034 -14.4465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8943 -14.0338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8943 -13.2166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6034 -12.8038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3166 -13.2166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4379 -13.1381 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1852 -12.8038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1012 -11.9923 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2987 -11.8163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8901 -12.5270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0687 -12.5270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6601 -11.8163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0687 -11.1139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8901 -11.1139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8388 -11.8163 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4302 -11.1139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6089 -11.1139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2003 -10.3991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3790 -10.3991 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8947 -11.0648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1175 -10.8118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1175 -9.9905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8947 -9.7375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4542 -11.2892 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
1 5 1 0
3 6 1 0
7 8 1 0
8 9 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
11 16 2 0
10 11 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 1 0
17 21 1 0
22 23 1 0
23 24 2 0
24 25 1 0
20 25 2 0
21 22 2 0
27 28 1 0
28 29 1 0
26 27 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
30 34 1 0
32 35 1 0
29 30 1 0
23 26 1 0
14 18 1 0
9 10 1 0
1 7 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 479.63Molecular Weight (Monoisotopic): 479.2896AlogP: 3.10#Rotatable Bonds: 11Polar Surface Area: 103.01Molecular Species: BASEHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.93CX LogP: 1.49CX LogD: -2.91Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.40Np Likeness Score: -0.99
References 1. Roy S, Mukherjee A, Paul B, Rahaman O, Roy S, Maithri G, Ramya B, Pal S, Ganguly D, Talukdar A.. (2017) Design and development of benzoxazole derivatives with toll-like receptor 9 antagonism., 134 [PMID:28437629 ] [10.1016/j.ejmech.2017.03.086 ]