(3S)-4-(1-(bis(4-chlorophenoxy)phosphoryl)butylamino)-3-((S)-3-(4-hydroxyphenyl)-2-((S)-3-methyl-2-(5-((3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)pentanamido)butanamido)propanamido)-4-oxobutanoic acid

ID: ALA4071346

PubChem CID: 137638228

Max Phase: Preclinical

Molecular Formula: C44H55Cl2N6O11PS

Molecular Weight: 977.90

Molecule Type: Small molecule

Associated Items:

Bioactivity Summary Target Summary Assay Summary

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES: CCCC(NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21)C(C)C)P(=O)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1

Standard InChI: InChI=1S/C44H55Cl2N6O11PS/c1-4-7-37(64(61,62-30-18-12-27(45)13-19-30)63-31-20-14-28(46)15-21-31)51-42(58)33(23-38(55)56)47-41(57)32(22-26-10-16-29(53)17-11-26)48-43(59)39(25(2)3)50-36(54)9-6-5-8-35-40-34(24-65-35)49-44(60)52-40/h10-21,25,32-35,37,39-40,53H,4-9,22-24H2,1-3H3,(H,47,57)(H,48,59)(H,50,54)(H,51,58)(H,55,56)(H2,49,52,60)/t32-,33-,34-,35-,37?,39-,40-/m0/s1

Standard InChI Key: QFLWZFQWSBQYPS-FPHNQDJVSA-N

Molfile:

     RDKit          2D

 67 71  0  0  0  0  0  0  0  0999 V2000
   20.0806   -6.0076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8430   -5.7316    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.0924   -6.8183    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.3428   -6.3878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8784   -7.0602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1464   -7.4393    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   22.1335   -6.6228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3704   -7.7059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4095   -5.5340    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.8543   -6.2328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4877   -7.7784    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   21.7484   -5.6697    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   25.6826   -5.4140    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.0962   -4.2882    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.5090   -5.0022    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   33.9215   -4.2857    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.1042   -6.2324    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.1042   -5.4110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8175   -5.0025    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.5307   -5.4110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2439   -4.1811    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.2439   -5.0025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5307   -6.2324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2439   -7.4675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2439   -6.6451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9544   -6.2339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6609   -6.6451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6609   -7.4674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9544   -7.8745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3740   -7.8760    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.9530   -5.4110    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.6662   -5.0025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3753   -6.2324    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.3753   -5.4110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6662   -4.1811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3753   -3.7684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3753   -2.9471    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.0885   -4.1811    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.0885   -5.0025    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.7976   -5.4110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7976   -6.2324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2223   -5.4116    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.5066   -3.5751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2223   -6.2330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5092   -6.6440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5089   -7.4646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2213   -7.8740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9355   -7.4610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9323   -6.6418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9212   -2.8642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5071   -2.1541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6849   -2.1561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2786   -2.8742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6910   -3.5813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2224   -8.6953    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   32.2732   -1.4461    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   26.3967   -5.0022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9751   -5.0050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2672   -5.4133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9755   -4.1878    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.5597   -5.0044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8518   -5.4126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3971   -4.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1050   -3.7767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6895   -3.7760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0899   -6.6410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0899   -7.4582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  2  1  0
  5  3  1  0
  6  8  1  0
  7  4  1  0
  8  5  1  0
  9  1  2  0
  7 10  1  6
  5 11  1  1
  4 12  1  1
  5  4  1  0
  6  7  1  0
 15 14  2  0
 16 15  1  0
 18 19  1  0
 22 31  1  0
 34 39  1  0
 18 17  2  0
 19 20  1  0
 20 22  1  0
 22 21  2  0
 20 23  1  6
 23 25  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 28 30  1  0
 31 32  1  0
 32 34  1  0
 34 33  2  0
 32 35  1  1
 35 36  1  0
 36 37  2  0
 36 38  1  0
 39 40  1  0
 40 15  1  0
 40 41  1  0
 15 42  1  0
 16 43  1  0
 42 44  1  0
 44 45  2  0
 45 46  1  0
 46 47  2  0
 47 48  1  0
 48 49  2  0
 49 44  1  0
 43 50  2  0
 50 51  1  0
 51 52  2  0
 52 53  1  0
 53 54  2  0
 54 43  1  0
 47 55  1  0
 52 56  1  0
 18 57  1  0
 57 13  1  0
 13 58  1  0
 58 59  1  0
 58 60  2  0
 59 61  1  0
 61 62  1  0
 62 10  1  0
 57 63  1  1
 63 64  1  0
 63 65  1  0
 41 66  1  0
 66 67  1  0
M  END

Associated Targets(Human)

PRTN3 Tchem Leukocyte proteinase 3 (201 Activities)

Discover Target: PRTN3

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

ELANE Tclin Leukocyte elastase (8173 Activities)

Discover Target: ELANE

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

Natural Product: No	Oral: No	Chemical Probe: No	Parenteral: No
Molecule Type: Small molecule	Topical: No	First In Class: No	Black Box: No
Chirality: No	Availability: No	Prodrug: No

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 977.90	Molecular Weight (Monoisotopic): 976.2764	AlogP: 6.15	#Rotatable Bonds: 24
Polar Surface Area: 250.59	Molecular Species: ACID	HBA: 11	HBD: 8
#RO5 Violations: 4	HBA (Lipinski): 17	HBD (Lipinski): 8	#RO5 Violations (Lipinski): 4
CX Acidic pKa: 3.77	CX Basic pKa: 3.77	CX LogP: 5.42	CX LogD: 2.10
Aromatic Rings: 3	Heavy Atoms: 65	QED Weighted: 0.03	Np Likeness Score: -0.07

References

1. Guarino C, Gruba N, Grzywa R, Dyguda-Kazimierowicz E, Hamon Y, Łȩgowska M, Skoreński M, Dallet-Choisy S, Marchand-Adam S, Kellenberger C, Jenne DE, Sieńczyk M, Lesner A, Gauthier F, Korkmaz B.. (2018) Exploiting the S4-S5 Specificity of Human Neutrophil Proteinase 3 to Improve the Potency of Peptidyl Di(chlorophenyl)-phosphonate Ester Inhibitors: A Kinetic and Molecular Modeling Analysis., 61 (5): [PMID:29442501] [10.1021/acs.jmedchem.7b01416]

(3S)-4-(1-(bis(4-chlorophenoxy)phosphoryl)butylamino)-3-((S)-3-(4-hydroxyphenyl)-2-((S)-3-methyl-2-(5-((3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)pentanamido)butanamido)propanamido)-4-oxobutanoic acid

Names and Identifiers

Alternative Forms

Associated Targets(Human)

Molecule Features

Drug Indications

Mechanisms of Action

Calculated Properties

References

Source