The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((1-(2-(6,7-Dimethoxy-3,4-dihydroisoquinolin-2(1H)-yl)ethyl)-1H-1,2,3-triazol-4-yl)methoxy)-N-(3-methoxyphenyl)benzamide ID: ALA4071352
PubChem CID: 137638514
Max Phase: Preclinical
Molecular Formula: C30H33N5O5
Molecular Weight: 543.62
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(NC(=O)c2ccccc2OCc2cn(CCN3CCc4cc(OC)c(OC)cc4C3)nn2)c1
Standard InChI: InChI=1S/C30H33N5O5/c1-37-25-8-6-7-23(17-25)31-30(36)26-9-4-5-10-27(26)40-20-24-19-35(33-32-24)14-13-34-12-11-21-15-28(38-2)29(39-3)16-22(21)18-34/h4-10,15-17,19H,11-14,18,20H2,1-3H3,(H,31,36)
Standard InChI Key: GQQAPGUMHVTVGJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
21.6954 -13.2731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6943 -14.0968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4065 -14.5058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1202 -14.0963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1174 -13.2695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4047 -12.8601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8327 -14.5038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8340 -15.3251 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.5398 -14.0941 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.2523 -14.5016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8277 -12.8541 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.5369 -13.2642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2472 -12.8488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9966 -13.1855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5453 -12.5720 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.1299 -11.8616 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.3271 -12.0347 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.3635 -12.5715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7717 -11.8595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5931 -11.8590 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.0028 -12.5770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8206 -12.5785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0009 -11.1517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8248 -11.1548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2297 -11.8697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0499 -11.8734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4663 -11.1630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0523 -10.4474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2334 -10.4472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4654 -9.7359 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.2876 -11.1653 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.6942 -11.8783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2867 -9.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2489 -15.3213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9606 -15.7329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6727 -15.3190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6688 -14.4935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9566 -14.0897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9614 -16.5501 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.2542 -16.9594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 2 0
7 9 1 0
9 10 1 0
5 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 17 2 0
17 13 1 0
15 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
20 23 1 0
21 22 1 0
22 25 1 0
24 23 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
28 30 1 0
27 31 1 0
31 32 1 0
30 33 1 0
10 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 10 1 0
35 39 1 0
39 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 543.62Molecular Weight (Monoisotopic): 543.2482AlogP: 4.19#Rotatable Bonds: 11Polar Surface Area: 99.97Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.14CX LogP: 4.07CX LogD: 3.88Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.30Np Likeness Score: -1.55
References 1. Pan M, Cui J, Jiao L, Ghaleb H, Liao C, Zhou J, Kairuki M, Lin H, Huang W, Qian H.. (2017) Synthesis and biological evaluation of JL-A7 derivatives as potent ABCB1 inhibitors., 25 (15): [PMID:28645831 ] [10.1016/j.bmc.2017.06.015 ]