7-Hydroxy-2-oxo-2H-chromene-3-carboxylic Acid [4-(4-Hydroxyphenyl)butyl]amide

ID: ALA4071420

PubChem CID: 137639882

Max Phase: Preclinical

Molecular Formula: C20H19NO5

Molecular Weight: 353.37

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(NCCCCc1ccc(O)cc1)c1cc2ccc(O)cc2oc1=O

Standard InChI:  InChI=1S/C20H19NO5/c22-15-7-4-13(5-8-15)3-1-2-10-21-19(24)17-11-14-6-9-16(23)12-18(14)26-20(17)25/h4-9,11-12,22-23H,1-3,10H2,(H,21,24)

Standard InChI Key:  GWBRUFXAFPGUAJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
    2.7019  -13.7684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7008  -14.5879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4088  -14.9969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4070  -13.3595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1156  -13.7648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1145  -14.5900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8246  -15.0013    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5404  -14.5920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5416  -13.7668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8269  -13.3509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2469  -15.0026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2503  -13.3600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9570  -13.7703    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2523  -12.5428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6657  -13.3634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3724  -13.7738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0811  -13.3669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9927  -14.9960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.7878  -13.7772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4965  -13.3704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2003  -13.7833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9085  -13.3771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9110  -12.5591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1993  -12.1489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4940  -12.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6191  -12.1513    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  8 11  2  0
  9 12  1  0
 12 13  1  0
 12 14  2  0
 13 15  1  0
 15 16  1  0
 16 17  1  0
  2 18  1  0
 17 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 23 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4071420

    ---

Associated Targets(Human)

AKR1B10 Tchem Aldo-keto reductase family 1 member B10 (300 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
AKR1B1 Tclin Aldose reductase (1404 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 353.37Molecular Weight (Monoisotopic): 353.1263AlogP: 2.96#Rotatable Bonds: 6
Polar Surface Area: 99.77Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 7.69CX Basic pKa: CX LogP: 3.08CX LogD: 2.91
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.47Np Likeness Score: -0.11

References

1. Endo S, Xia S, Suyama M, Morikawa Y, Oguri H, Hu D, Ao Y, Takahara S, Horino Y, Hayakawa Y, Watanabe Y, Gouda H, Hara A, Kuwata K, Toyooka N, Matsunaga T, Ikari A..  (2017)  Synthesis of Potent and Selective Inhibitors of Aldo-Keto Reductase 1B10 and Their Efficacy against Proliferation, Metastasis, and Cisplatin Resistance of Lung Cancer Cells.,  60  (20): [PMID:28976752] [10.1021/acs.jmedchem.7b00830]

Source