The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-(4-Ethylphenylamino)benzo[d]oxazol-5-yl)-2-chloro-5-nitrobenzamide ID: ALA4071513
PubChem CID: 54765630
Max Phase: Preclinical
Molecular Formula: C22H17ClN4O4
Molecular Weight: 436.86
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCc1ccc(Nc2nc3cc(NC(=O)c4cc([N+](=O)[O-])ccc4Cl)ccc3o2)cc1
Standard InChI: InChI=1S/C22H17ClN4O4/c1-2-13-3-5-14(6-4-13)25-22-26-19-11-15(7-10-20(19)31-22)24-21(28)17-12-16(27(29)30)8-9-18(17)23/h3-12H,2H2,1H3,(H,24,28)(H,25,26)
Standard InChI Key: IGNWUQGZXIQDTJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
4.4766 -13.1328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4755 -13.9523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1835 -14.3613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1817 -12.7239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8904 -13.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8951 -13.9478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6752 -14.1963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1525 -13.5311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6674 -12.8718 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9697 -13.5263 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3741 -12.8162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1912 -12.8142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5956 -12.1049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1828 -11.3986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3614 -11.4061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9607 -12.1159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5862 -10.6880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1725 -9.9832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7688 -12.7244 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7686 -11.9072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0608 -11.4988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4762 -11.4984 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0659 -10.6808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3589 -10.2725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6503 -10.6813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6532 -11.5027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3607 -11.9073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3643 -12.7245 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.3589 -9.4502 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6513 -9.0414 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0667 -9.0418 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
8 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
14 17 1 0
17 18 1 0
1 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
21 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 21 1 0
27 28 1 0
29 30 2 0
29 31 1 0
24 29 1 0
M CHG 2 29 1 31 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 436.86Molecular Weight (Monoisotopic): 436.0938AlogP: 5.95#Rotatable Bonds: 6Polar Surface Area: 110.30Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.29CX Basic pKa: ┄CX LogP: 6.04CX LogD: 6.04Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.29Np Likeness Score: -1.98
References 1. Kim D, Won HY, Hwang ES, Kim YK, Choo HP.. (2017) Synthesis of benzoxazole derivatives as interleukin-6 antagonists., 25 (12): [PMID:28442260 ] [10.1016/j.bmc.2017.03.072 ]