The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(5-chloro-2-(4-(4-methoxyphenylsulfonamido)phenylamino)pyrimidin-4-yloxy)phenyl)acrylamide ID: ALA4071567
PubChem CID: 137639108
Max Phase: Preclinical
Molecular Formula: C26H22ClN5O5S
Molecular Weight: 552.01
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(NS(=O)(=O)c4ccc(OC)cc4)cc3)ncc2Cl)c1
Standard InChI: InChI=1S/C26H22ClN5O5S/c1-3-24(33)29-19-5-4-6-21(15-19)37-25-23(27)16-28-26(31-25)30-17-7-9-18(10-8-17)32-38(34,35)22-13-11-20(36-2)12-14-22/h3-16,32H,1H2,2H3,(H,29,33)(H,28,30,31)
Standard InChI Key: JAZDXGNHKJRAMD-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
2.6208 -27.4083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4458 -27.4083 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.0333 -26.6938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8778 -22.4582 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8765 -23.2857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5914 -23.6985 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3078 -23.2852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3050 -22.4546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5896 -22.0455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0230 -23.6966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0243 -24.5216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1618 -23.6976 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1611 -24.5226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4462 -24.9330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4452 -25.7572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1599 -26.1711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8771 -25.7547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8745 -24.9318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3091 -24.9336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3100 -25.7578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0257 -26.1700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7419 -25.7519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7374 -24.9291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4584 -26.1608 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4627 -26.9858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1792 -27.3946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7502 -27.4019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1834 -28.2197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1604 -26.9961 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4465 -28.2339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7301 -28.6440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7302 -29.4683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4455 -29.8812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1621 -29.4638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1585 -28.6410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0179 -22.0395 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.4470 -30.7062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7334 -31.1200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
7 10 1 0
10 11 1 0
5 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
11 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 11 1 0
22 24 1 0
24 25 1 0
25 26 1 0
25 27 2 0
26 28 2 0
16 29 1 0
29 2 1 0
2 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
8 36 1 0
33 37 1 0
37 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 552.01Molecular Weight (Monoisotopic): 551.1030AlogP: 5.60#Rotatable Bonds: 10Polar Surface Area: 131.54Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.51CX Basic pKa: 1.73CX LogP: 5.19CX LogD: 5.16Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.22Np Likeness Score: -1.43
References 1. Liu H, Qu M, Xu L, Han X, Wang C, Shu X, Yao J, Liu K, Peng J, Li Y, Ma X.. (2017) Design and synthesis of sulfonamide-substituted diphenylpyrimidines (SFA-DPPYs) as potent Bruton's tyrosine kinase (BTK) inhibitors with improved activity toward B-cell lymphoblastic leukemia., 135 [PMID:28432946 ] [10.1016/j.ejmech.2017.04.037 ]