The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-(4-((S)-3-(((R)-1-(naphthalen-1-yl)ethyl)amino)pyrrolidin-1-yl)benzamido)propyl)piperidine-4-carboxylic acid ID: ALA4071600
PubChem CID: 137628638
Max Phase: Preclinical
Molecular Formula: C32H40N4O3
Molecular Weight: 528.70
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H](N[C@H]1CCN(c2ccc(C(=O)NCCCN3CCC(C(=O)O)CC3)cc2)C1)c1cccc2ccccc12
Standard InChI: InChI=1S/C32H40N4O3/c1-23(29-9-4-7-24-6-2-3-8-30(24)29)34-27-16-21-36(22-27)28-12-10-25(11-13-28)31(37)33-17-5-18-35-19-14-26(15-20-35)32(38)39/h2-4,6-13,23,26-27,34H,5,14-22H2,1H3,(H,33,37)(H,38,39)/t23-,27+/m1/s1
Standard InChI Key: HBTVUVNVTSSIHP-KCWPFWIISA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
15.1552 -5.9267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3710 -5.0558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3699 -5.8754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7848 -5.0522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0761 -4.6470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7876 -5.8749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0771 -6.2822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0756 -7.0992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7838 -7.5100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4950 -7.0977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4930 -6.2820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2002 -5.8725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9084 -6.2802 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1991 -5.0553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6156 -5.8707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3629 -6.2001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9090 -5.5921 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4994 -4.8849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7004 -5.0560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7218 -5.6765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0509 -6.4240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8629 -6.5086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3433 -5.8464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0058 -5.0975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1948 -5.0165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4905 -6.6754 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.0119 -7.3378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6327 -5.2636 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3463 -8.0834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1592 -8.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4935 -8.9124 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0129 -9.5721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3440 -10.3154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1568 -10.4029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6376 -9.7409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3055 -8.9914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4883 -11.1498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0072 -11.8104 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.3009 -11.2362 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 7 1 0
6 4 1 0
4 5 2 0
5 2 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 6 2 0
11 12 1 0
12 13 1 0
12 14 1 1
15 13 1 1
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 15 1 0
17 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
23 1 1 0
1 26 1 0
26 27 1 0
1 28 2 0
27 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
31 36 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
34 37 1 0
37 38 1 0
37 39 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 528.70Molecular Weight (Monoisotopic): 528.3100AlogP: 4.69#Rotatable Bonds: 10Polar Surface Area: 84.91Molecular Species: ZWITTERIONHBA: 5HBD: 3#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.12CX Basic pKa: 9.66CX LogP: 1.12CX LogD: -0.17Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.33Np Likeness Score: -1.28
References 1. Sparks SM, Spearing PK, Diaz CJ, Cowan DJ, Jayawickreme C, Chen G, Rimele TJ, Generaux C, Harston LT, Roller SG.. (2017) Identification of potent, nonabsorbable agonists of the calcium-sensing receptor for GI-specific administration., 27 (20): [PMID:28916340 ] [10.1016/j.bmcl.2017.09.008 ]