2-(Benzo[d][1,3]dioxol-5-yl)-3-(6-(2-(benzo[d][1,3]dioxol-5-yl-methylene)hydrazinyl)hexanoyl)-2,3-dihydroquinazolin-4(1H)-one

ID: ALA4071678

PubChem CID: 137638398

Max Phase: Preclinical

Molecular Formula: C29H28N4O6

Molecular Weight: 528.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CCCCCN1C(=O)c2ccccc2NC1c1ccc2c(c1)OCO2)N/N=C/c1ccc2c(c1)OCO2

Standard InChI:  InChI=1S/C29H28N4O6/c34-27(32-30-16-19-9-11-23-25(14-19)38-17-36-23)8-2-1-5-13-33-28(20-10-12-24-26(15-20)39-18-37-24)31-22-7-4-3-6-21(22)29(33)35/h3-4,6-7,9-12,14-16,28,31H,1-2,5,8,13,17-18H2,(H,32,34)/b30-16+

Standard InChI Key:  BSKNSXRMZOZAMS-OKCVXOCRSA-N

Molfile:  

     RDKit          2D

 39 44  0  0  0  0  0  0  0  0999 V2000
    8.8320   -7.6223    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5397   -7.2137    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2474   -7.6223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9551   -7.2137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6615   -7.6267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3687   -7.2188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9522   -6.4026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6565   -5.9923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3667   -6.4045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9783   -5.8564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6460   -5.1054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8291   -5.1894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4708   -3.9332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4696   -4.7527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1777   -5.1617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1759   -3.5243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8845   -3.9296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8834   -4.7503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5896   -5.1593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3014   -4.7523    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3026   -3.9316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5919   -3.5180    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5873   -5.9765    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0113   -3.5247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0080   -5.1628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0057   -5.9800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7123   -6.3906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4211   -5.9840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1277   -6.3945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1254   -7.2117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4166   -7.6183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7165   -3.9397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4247   -3.5335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0101   -2.7138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7154   -2.3053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4248   -2.7145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0332   -2.1663    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6999   -1.4182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8855   -1.5042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12  8  1  0
 13 14  2  0
 14 15  1  0
 15 18  2  0
 17 16  2  0
 16 13  1  0
 17 18  1  0
 17 22  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 19 23  2  0
 21 24  1  0
 20 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30  1  1  0
 30 31  2  0
 24 32  2  0
 32 33  1  0
 33 36  2  0
 35 34  2  0
 34 24  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 39 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4071678

    ---

Associated Targets(non-human)

Leishmania aethiopica (127 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 528.57Molecular Weight (Monoisotopic): 528.2009AlogP: 4.42#Rotatable Bonds: 9
Polar Surface Area: 110.72Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.76CX Basic pKa: 1.55CX LogP: 4.74CX LogD: 4.74
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.24Np Likeness Score: -0.88

References

1. Khattab SN, Haiba NS, Asal AM, Bekhit AA, Guemei AA, Amer A, El-Faham A..  (2017)  Study of antileishmanial activity of 2-aminobenzoyl amino acid hydrazides and their quinazoline derivatives.,  27  (4): [PMID:28087274] [10.1016/j.bmcl.2017.01.003]

Source