The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1,2-Dihydro-2-imino-6-(4-methoxy-7-methyl-5-oxo-5H-furo[3,2-g]chromen-6-yl)-4-(3,4-dimethoxyphenyl)pyridine-3-carbonitrile ID: ALA4071708
PubChem CID: 137638402
Max Phase: Preclinical
Molecular Formula: C27H21N3O6
Molecular Weight: 483.48
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2cc(-c3c(C)oc4cc5occc5c(OC)c4c3=O)[nH]c(=N)c2C#N)cc1OC
Standard InChI: InChI=1S/C27H21N3O6/c1-13-23(25(31)24-22(36-13)11-20-15(7-8-35-20)26(24)34-4)18-10-16(17(12-28)27(29)30-18)14-5-6-19(32-2)21(9-14)33-3/h5-11H,1-4H3,(H2,29,30)
Standard InChI Key: JATKIRZRXGKMBU-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
30.3175 -16.5012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3190 -15.6796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6152 -15.2698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9016 -15.6773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9027 -16.4905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6065 -16.9045 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.0300 -15.2805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7363 -14.8741 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.0200 -16.9120 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.1923 -17.7157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1923 -16.8968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4819 -16.4905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7747 -16.8968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0684 -16.4905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3559 -16.8968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3559 -17.7157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0684 -18.1220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7747 -17.7157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4819 -18.1220 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.5788 -17.9667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.5788 -16.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0999 -17.3031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4819 -15.6716 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.9027 -18.1220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0684 -15.6716 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.3559 -15.2590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6142 -14.4566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3246 -14.0503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3283 -13.2331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6245 -12.8192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9141 -13.2255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9104 -14.0426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6273 -12.0007 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.9209 -11.5898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0386 -12.8290 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.7437 -13.2421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
1 6 1 0
7 8 3 0
2 7 1 0
1 9 2 0
10 11 2 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
13 18 2 0
18 19 1 0
10 19 1 0
21 22 2 0
20 22 1 0
15 21 1 0
16 20 1 0
12 23 2 0
10 24 1 0
25 26 1 0
14 25 1 0
5 11 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
27 32 2 0
30 33 1 0
3 27 1 0
33 34 1 0
29 35 1 0
35 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.48Molecular Weight (Monoisotopic): 483.1430AlogP: 4.89#Rotatable Bonds: 5Polar Surface Area: 134.47Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.55CX Basic pKa: 8.38CX LogP: 1.82CX LogD: 1.34Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.36Np Likeness Score: 0.26
References 1. Amin KM, Syam YM, Anwar MM, Ali HI, Abdel-Ghani TM, Serry AM.. (2017) Synthesis and molecular docking studies of new furochromone derivatives as p38α MAPK inhibitors targeting human breast cancer MCF-7 cells., 25 (8): [PMID:28291685 ] [10.1016/j.bmc.2017.02.065 ]