The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3R,4R)-N-hydroxy-3-methyl-4-[({4-[(2-methylquinolin-4-yl)methoxy]phenyl}sulfonyl)amino]tetrahydro-2H-pyran-3-carboxamide ID: ALA4071782
PubChem CID: 11856141
Max Phase: Preclinical
Molecular Formula: C24H27N3O6S
Molecular Weight: 485.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(COc2ccc(S(=O)(=O)N[C@@H]3CCOC[C@]3(C)C(=O)NO)cc2)c2ccccc2n1
Standard InChI: InChI=1S/C24H27N3O6S/c1-16-13-17(20-5-3-4-6-21(20)25-16)14-33-18-7-9-19(10-8-18)34(30,31)27-22-11-12-32-15-24(22,2)23(28)26-29/h3-10,13,22,27,29H,11-12,14-15H2,1-2H3,(H,26,28)/t22-,24+/m1/s1
Standard InChI Key: AKDFMUYQSXECQD-VWNXMTODSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
11.0582 -9.4623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4749 -10.1790 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.8872 -9.4598 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3317 -9.3415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3306 -10.1688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0453 -10.5817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0436 -8.9287 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7590 -9.3379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7597 -10.1647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4750 -10.5757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1900 -10.1609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1852 -9.3309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4694 -8.9237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6171 -8.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0472 -11.4067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3338 -11.8208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6183 -11.4100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6210 -10.5858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9065 -10.1751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1920 -10.5892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1966 -11.4185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9117 -11.8255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7631 -10.5944 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7661 -11.4194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0520 -11.8281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0530 -12.6496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7672 -13.0633 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4819 -12.6495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4826 -11.8218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3381 -11.4148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3391 -10.5898 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6231 -11.8264 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9092 -11.4130 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4623 -12.4082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
4 14 1 0
6 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
20 2 1 0
2 23 1 0
24 23 1 6
24 25 1 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
25 30 1 6
30 31 2 0
30 32 1 0
32 33 1 0
25 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 485.56Molecular Weight (Monoisotopic): 485.1621AlogP: 2.70#Rotatable Bonds: 7Polar Surface Area: 126.85Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.79CX Basic pKa: 5.02CX LogP: 1.97CX LogD: 1.95Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.35Np Likeness Score: -0.72
References 1. Ouvry G, Berton Y, Bhurruth-Alcor Y, Bonnary L, Bouix-Peter C, Bouquet K, Bourotte M, Chambon S, Comino C, Deprez B, Duvert D, Duvert G, Hacini-Rachinel F, Harris CS, Luzy AP, Mathieu A, Millois C, Pascau J, Pinto A, Polge G, Reitz A, Reversé K, Rosignoli C, Taquet N, Hennequin LF.. (2017) Identification of novel TACE inhibitors compatible with topical application., 27 (8): [PMID:28274635 ] [10.1016/j.bmcl.2017.02.035 ]