2-(2-(Benzo[d][1,3]dioxol-5-yl)-1,2-dihydro-4-oxoquinazolin-3(4H)-yl)-N'-((benzo[d][1,3]dioxol-5-yl)methylene)acetohydrazide

ID: ALA4071879

PubChem CID: 137639121

Max Phase: Preclinical

Molecular Formula: C25H20N4O6

Molecular Weight: 472.46

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CN1C(=O)c2ccccc2NC1c1ccc2c(c1)OCO2)N/N=C/c1ccc2c(c1)OCO2

Standard InChI:  InChI=1S/C25H20N4O6/c30-23(28-26-11-15-5-7-19-21(9-15)34-13-32-19)12-29-24(16-6-8-20-22(10-16)35-14-33-20)27-18-4-2-1-3-17(18)25(29)31/h1-11,24,27H,12-14H2,(H,28,30)/b26-11+

Standard InChI Key:  VOWGULMGFQLWBG-KBKYJPHKSA-N

Molfile:  

     RDKit          2D

 35 40  0  0  0  0  0  0  0  0999 V2000
    8.2572   -3.4049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2560   -4.2245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9641   -4.6334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9623   -2.9961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6709   -3.4013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6697   -4.2220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3759   -4.6310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0878   -4.2240    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0890   -3.4033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3783   -2.9897    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3737   -5.4482    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7977   -2.9964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7944   -4.6345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7921   -5.4517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4987   -5.8623    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0833   -5.8583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4964   -6.6795    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.2029   -7.0901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2007   -7.9072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4918   -8.3087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4891   -9.1251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9066   -8.3104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9074   -9.1255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1991   -9.5381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3726  -10.3393    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1882  -10.4219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5187   -9.6717    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5028   -3.4114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2110   -3.0052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7965   -2.1855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5018   -1.7770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2111   -2.1862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8196   -1.6380    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.4862   -0.8899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6718   -0.9759    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  7 11  2  0
  9 12  1  0
  8 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 24  2  0
 23 22  2  0
 22 19  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 23  1  0
 12 28  2  0
 28 29  1  0
 29 32  2  0
 31 30  2  0
 30 12  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4071879

    ---

Associated Targets(non-human)

Leishmania aethiopica (127 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 472.46Molecular Weight (Monoisotopic): 472.1383AlogP: 2.86#Rotatable Bonds: 5
Polar Surface Area: 110.72Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.62CX Basic pKa: 1.24CX LogP: 3.33CX LogD: 3.33
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.43Np Likeness Score: -0.96

References

1. Khattab SN, Haiba NS, Asal AM, Bekhit AA, Guemei AA, Amer A, El-Faham A..  (2017)  Study of antileishmanial activity of 2-aminobenzoyl amino acid hydrazides and their quinazoline derivatives.,  27  (4): [PMID:28087274] [10.1016/j.bmcl.2017.01.003]

Source