The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Diethyl {2-benzyl-5-[(3-(4-fluorobenzoyl)-2,4-dioxo-3,4-dihydroquinazolin-1(2H)-yl)methyl]isoxazolidin-3-yl}phosphonate ID: ALA4071913
PubChem CID: 137638691
Max Phase: Preclinical
Molecular Formula: C30H31FN3O7P
Molecular Weight: 595.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOP(=O)(OCC)C1CC(Cn2c(=O)n(C(=O)c3ccc(F)cc3)c(=O)c3ccccc32)ON1Cc1ccccc1
Standard InChI: InChI=1S/C30H31FN3O7P/c1-3-39-42(38,40-4-2)27-18-24(41-33(27)19-21-10-6-5-7-11-21)20-32-26-13-9-8-12-25(26)29(36)34(30(32)37)28(35)22-14-16-23(31)17-15-22/h5-17,24,27H,3-4,18-20H2,1-2H3
Standard InChI Key: HKDVYNSQYNACAW-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
8.7611 -4.5777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9621 -8.2641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5975 -4.5886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2988 -7.1121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1806 -4.5839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6331 -8.2161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9303 -7.6390 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
8.0532 -5.8111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0507 -7.4488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1788 -6.2248 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5941 -6.2309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4505 -11.2570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4690 -4.9903 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7466 -7.7252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3065 -4.9953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3483 -6.2206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1205 -9.7567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3494 -4.5842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3067 -5.8204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4495 -8.3023 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6373 -5.8123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1593 -8.4357 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.0204 -6.2341 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.8857 -5.8164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6027 -10.4164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9705 -10.5941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1830 -3.7630 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2679 -11.1751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0558 -4.9921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4690 -5.8111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7611 -7.0404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1482 -8.8795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7611 -6.2195 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9211 -9.0535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7597 -3.7568 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5988 -6.8895 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3087 -9.8487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8238 -9.1853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3308 -9.7655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3364 -8.3447 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6359 -4.9901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8898 -4.9944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18 41 2 0
25 17 2 0
7 36 2 0
11 19 2 0
8 29 2 0
3 42 1 0
17 37 1 0
13 5 1 0
4 14 1 0
22 2 1 0
42 24 2 0
37 26 2 0
15 3 2 0
9 4 1 0
14 7 1 0
29 18 1 0
33 31 1 0
30 13 1 0
19 15 1 0
7 40 1 0
13 1 1 0
29 1 1 0
21 16 2 0
8 33 1 0
22 38 1 0
28 25 1 0
38 37 1 0
40 34 1 0
9 31 1 0
2 9 1 0
34 39 1 0
7 20 1 0
12 28 2 0
5 27 2 0
26 12 1 0
16 8 1 0
20 6 1 0
14 22 1 0
6 32 1 0
24 11 1 0
1 35 2 0
5 42 1 0
33 30 1 0
30 10 2 0
19 23 1 0
41 21 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 595.56Molecular Weight (Monoisotopic): 595.1884AlogP: 4.79#Rotatable Bonds: 10Polar Surface Area: 109.07Molecular Species: NEUTRALHBA: 10HBD: ┄#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.77CX LogD: 4.77Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.24Np Likeness Score: -0.60
References 1. Piotrowska DG, Andrei G, Schols D, Snoeck R, Łysakowska M.. (2017) Synthesis, anti-varicella-zoster virus and anti-cytomegalovirus activity of quinazoline-2,4-diones containing isoxazolidine and phosphonate substructures., 126 [PMID:27750154 ] [10.1016/j.ejmech.2016.10.002 ]