2,4-Dichloro-N-(1-(naphthalen-2-ylmethyl)piperidin-4-yl)benzamide

ID: ALA4072046

PubChem CID: 137638838

Max Phase: Preclinical

Molecular Formula: C23H22Cl2N2O

Molecular Weight: 413.35

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(NC1CCN(Cc2ccc3ccccc3c2)CC1)c1ccc(Cl)cc1Cl

Standard InChI:  InChI=1S/C23H22Cl2N2O/c24-19-7-8-21(22(25)14-19)23(28)26-20-9-11-27(12-10-20)15-16-5-6-17-3-1-2-4-18(17)13-16/h1-8,13-14,20H,9-12,15H2,(H,26,28)

Standard InChI Key:  DZEGOFZJGREHGY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   33.7139   -2.8931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7128   -3.7168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4249   -4.1299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1387   -3.7163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1359   -2.8895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4232   -2.4843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4207   -1.6630    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   33.0006   -4.1290    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   35.8462   -2.4783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5554   -2.8842    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.8431   -1.6570    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.2657   -2.4730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9777   -2.8816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6859   -2.4738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6870   -1.6521    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.9738   -1.2399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2595   -1.6535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3989   -1.2394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1107   -1.6522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1056   -2.4733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8166   -2.8818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8153   -1.2387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5227   -1.6476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5215   -2.4704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2329   -2.8790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9459   -2.4701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9432   -1.6442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2312   -1.2351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  2  8  1  0
  5  9  1  0
  9 10  1  0
  9 11  2  0
 10 12  1  0
 12 13  1  0
 12 17  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 15 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 24  2  0
 23 22  2  0
 22 19  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4072046

    ---

Associated Targets(Human)

SLC6A1 Tclin GABA transporter 1 (308 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SLC6A12 Tchem Betaine transporter (274 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SLC6A13 Tchem GABA transporter 2 (120 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SLC6A11 Tchem GABA transporter 3 (176 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 413.35Molecular Weight (Monoisotopic): 412.1109AlogP: 5.54#Rotatable Bonds: 4
Polar Surface Area: 32.34Molecular Species: BASEHBA: 2HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.53CX Basic pKa: 8.58CX LogP: 5.00CX LogD: 3.79
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.61Np Likeness Score: -1.59

References

1. Jørgensen L, Al-Khawaja A, Kickinger S, Vogensen SB, Skovgaard-Petersen J, Rosenthal E, Borkar N, Löffler R, Madsen KK, Bräuner-Osborne H, Schousboe A, Ecker GF, Wellendorph P, Clausen RP..  (2017)  Structure-Activity Relationship, Pharmacological Characterization, and Molecular Modeling of Noncompetitive Inhibitors of the Betaine/γ-Aminobutyric Acid Transporter 1 (BGT1).,  60  (21): [PMID:28991462] [10.1021/acs.jmedchem.7b00924]

Source