Euphoboetirane K

ID: ALA4072099

PubChem CID: 137639311

Max Phase: Preclinical

Molecular Formula: C28H33F3O5

Molecular Weight: 506.56

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=C1CC[C@H]2[C@@H](/C=C(\C)C(=O)[C@@]3(O)C[C@H](C)[C@H](O)[C@@H]3[C@H]1OC(=O)c1ccc(C(F)(F)F)cc1)C2(C)C

Standard InChI:  InChI=1S/C28H33F3O5/c1-14-6-11-19-20(26(19,4)5)12-15(2)24(33)27(35)13-16(3)22(32)21(27)23(14)36-25(34)17-7-9-18(10-8-17)28(29,30)31/h7-10,12,16,19-23,32,35H,1,6,11,13H2,2-5H3/b15-12+/t16-,19-,20+,21+,22-,23-,27+/m0/s1

Standard InChI Key:  VGXGRVUQBCGUSI-UJHYWZLMSA-N

Molfile:  

     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
   16.7565  -11.0981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3237   -8.6465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9192   -9.3564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7362   -9.3518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9402   -9.1247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9403  -11.0988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7598   -9.1246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3572  -10.5275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3610   -9.7039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5789   -9.4459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0918  -10.1100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5729  -10.7783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3349   -9.7039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3386  -10.5228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1186  -10.7724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1126   -9.4474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5946  -10.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0739   -8.3702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6274   -8.3698    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4104  -10.1035    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   18.1062   -8.6300    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.2746  -10.1063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3168  -11.5544    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1387  -11.3127    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.6317  -11.8555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9447   -8.9932    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1327  -12.5011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8241  -13.2577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9423  -12.3899    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.0674  -11.8539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0141  -13.3658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7055  -14.1216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2067  -14.7682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0202  -14.6539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3250  -13.8980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8992  -15.5253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0897  -15.6375    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.4010  -16.1702    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   14.4824  -16.2283    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  1  0
  4  3  1  0
  9  5  1  0
  8  6  1  0
  6  1  1  0
  1 14  1  0
 13  7  2  0
  7  5  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12  8  1  0
 14 15  1  0
 15 17  1  0
 16 13  1  0
 17 16  1  0
  3 17  1  0
 16  3  1  0
  7 18  1  0
  5 19  2  0
 17 20  1  6
 16 21  1  6
 11 22  1  1
 12 23  1  1
  8 24  1  6
  6 25  1  6
  9 26  1  1
 25 27  1  0
 27 28  1  0
 27 29  2  0
  1 30  2  0
 28 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 28  1  0
 33 36  1  0
 36 37  1  0
 36 38  1  0
 36 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4072099

    ---

Associated Targets(non-human)

Saccharomyces cerevisiae (19171 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 506.56Molecular Weight (Monoisotopic): 506.2280AlogP: 5.12#Rotatable Bonds: 2
Polar Surface Area: 83.83Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.64CX Basic pKa: CX LogP: 5.71CX LogD: 5.71
Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.43Np Likeness Score: 2.09

References

1. Mónico A, Nim S, Duarte N, Rawal MK, Prasad R, Di Pietro A, Ferreira MU..  (2017)  Lathyrol and epoxylathyrol derivatives: Modulation of Cdr1p and Mdr1p drug-efflux transporters of Candida albicans in Saccharomyces cerevisiae model.,  25  (13): [PMID:28479022] [10.1016/j.bmc.2017.04.016]

Source