Tinosinenoside B

ID: ALA4072659

PubChem CID: 132576357

Max Phase: Preclinical

Molecular Formula: C25H32O11

Molecular Weight: 508.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@]12CC[C@@]3(O)C(=O)O[C@H](c4ccoc4)C[C@@]3(C)[C@@H]1[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C=CC2=O

Standard InChI:  InChI=1S/C25H32O11/c1-23-6-7-25(32)22(31)36-14(12-5-8-33-11-12)9-24(25,2)20(23)13(3-4-16(23)27)34-21-19(30)18(29)17(28)15(10-26)35-21/h3-5,8,11,13-15,17-21,26,28-30,32H,6-7,9-10H2,1-2H3/t13-,14-,15+,17+,18-,19+,20+,21+,23-,24-,25+/m0/s1

Standard InChI Key:  DYDGOMPDSTZRJD-KHTDIVMNSA-N

Molfile:  

     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
    3.9990  -13.4878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9990  -14.2967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7002  -14.6991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7002  -13.0770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3974  -13.4878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3963  -14.2967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0927  -14.7023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7970  -14.3016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0991  -13.0803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7965  -13.4924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5019  -13.0995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5110  -12.2881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8136  -11.8760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1029  -12.2713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8221  -11.0651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4860  -10.5931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2458   -9.8195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4327   -9.8084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1720  -10.5809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7882  -12.6831    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0925  -13.8922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3905  -12.6747    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3883  -15.1035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1989  -13.5134    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6926  -15.5121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7013  -12.2598    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9941  -11.8503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9960  -11.0334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2929  -10.6239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5822  -11.0281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5792  -11.8463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2868  -12.2602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2970   -9.8068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5914   -9.3946    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8766  -10.6160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8696  -12.2515    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2852  -13.0774    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6968  -11.4366    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  4  1  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  5  9  1  0
  6  7  1  0
  7  8  1  0
  8 10  1  0
  9 10  1  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 15  1  0
 13 15  1  1
 10 20  1  1
  9 21  1  1
  5 22  1  6
  6 23  1  6
 11 24  2  0
  3 25  2  0
  4 26  1  6
 27 26  1  0
 27 28  1  0
 27 32  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 29 33  1  1
 33 34  1  0
 30 35  1  6
 31 36  1  1
 32 37  1  6
 27 38  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4072659

    ---

Associated Targets(Human)

N9 (414 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HeLa (62764 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 508.52Molecular Weight (Monoisotopic): 508.1945AlogP: -0.25#Rotatable Bonds: 4
Polar Surface Area: 176.12Molecular Species: NEUTRALHBA: 11HBD: 5
#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.80CX Basic pKa: CX LogP: 0.03CX LogD: 0.03
Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.34Np Likeness Score: 3.03

References

1. Jiang H, Zhang GJ, Liu YF, Wang HS, Liang D..  (2017)  Clerodane Diterpenoid Glucosides from the Stems of Tinospora sinensis.,  80  (4): [PMID:28358196] [10.1021/acs.jnatprod.6b00976]

Source