The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(2-chloro-7-((methylamino)methyl)naphthalen-1-yl)-4-(1-methyl-1H-indol-3-yl)-1H-pyrrole-2,5-dione ID: ALA4072879
PubChem CID: 11604381
Max Phase: Preclinical
Molecular Formula: C25H20ClN3O2
Molecular Weight: 429.91
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CNCc1ccc2ccc(Cl)c(C3=C(c4cn(C)c5ccccc45)C(=O)NC3=O)c2c1
Standard InChI: InChI=1S/C25H20ClN3O2/c1-27-12-14-7-8-15-9-10-19(26)21(17(15)11-14)23-22(24(30)28-25(23)31)18-13-29(2)20-6-4-3-5-16(18)20/h3-11,13,27H,12H2,1-2H3,(H,28,30,31)
Standard InChI Key: ZMHXVAQNZDUNOG-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
31.2059 -18.6840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0231 -18.6840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2775 -17.9073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6145 -17.4252 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.9558 -17.9073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5000 -19.3439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2466 -20.1208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9072 -20.6019 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.3172 -19.3449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5672 -20.1188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3608 -20.2880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9053 -19.6841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6506 -18.9084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8576 -18.7429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5589 -19.3312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7848 -19.0557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1621 -19.5889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3127 -20.3964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7110 -20.1329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0924 -20.6654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2449 -21.4653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0154 -21.7338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6337 -21.1963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4781 -20.3984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0550 -17.6558 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.1785 -17.6551 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.6360 -18.2521 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
32.9082 -21.4191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4065 -21.4621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5627 -22.2643 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.3354 -22.5301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
6 7 2 0
7 8 1 0
8 10 1 0
9 6 1 0
2 6 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
1 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 20 1 0
19 15 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 19 2 0
3 25 2 0
5 26 2 0
16 27 1 0
8 28 1 0
23 29 1 0
29 30 1 0
30 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 429.91Molecular Weight (Monoisotopic): 429.1244AlogP: 4.27#Rotatable Bonds: 4Polar Surface Area: 63.13Molecular Species: BASEHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.00CX Basic pKa: 9.31CX LogP: 3.70CX LogD: 2.15Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.48Np Likeness Score: -0.32
References 1. van Eis MJ, Evenou J, Schuler W, Zenke G, Vangrevelinghe E, Wagner J, von Matt P.. (2017) Indolyl-naphthyl-maleimides as potent and selective inhibitors of protein kinase C-α/β., 27 (4): [PMID:28131714 ] [10.1016/j.bmcl.2017.01.038 ]