The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-(((2S,5R)-5-((R)-hydroxy(phenyl)methyl)pyrrolidin-2-yl)methyl)phenyl)(4-(pyridin-2-ylmethyl)piperazin-1-yl)methanone ID: ALA4073137
PubChem CID: 67972431
Max Phase: Preclinical
Molecular Formula: C29H34N4O2
Molecular Weight: 470.62
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1ccc(C[C@@H]2CC[C@H]([C@H](O)c3ccccc3)N2)cc1)N1CCN(Cc2ccccn2)CC1
Standard InChI: InChI=1S/C29H34N4O2/c34-28(23-6-2-1-3-7-23)27-14-13-25(31-27)20-22-9-11-24(12-10-22)29(35)33-18-16-32(17-19-33)21-26-8-4-5-15-30-26/h1-12,15,25,27-28,31,34H,13-14,16-21H2/t25-,27+,28+/m0/s1
Standard InChI Key: LNFRMPJWRZFBPR-KJYTXNCISA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
1.3436 -2.4456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3418 -3.2663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0514 -3.6796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7635 -3.2656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7592 -2.4401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0487 -2.0366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4701 -2.0275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1815 -2.4362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4654 -1.2103 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2689 -3.2493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0723 -3.4197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4769 -2.7082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9296 -2.1009 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2951 -2.6194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7791 -3.2799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4433 -4.0257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9262 -4.6897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7458 -4.6014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0747 -3.8447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5888 -3.1856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2269 -5.2609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8984 -6.0108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0449 -5.1705 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5251 -5.8341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3380 -5.7473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6726 -4.9954 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1889 -4.3371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3705 -4.4225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4870 -4.9096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9685 -5.5719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6364 -6.3219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1168 -6.9835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9326 -6.8983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2644 -6.1428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7809 -5.4818 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5990 -3.0145 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
7 9 1 1
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 8 1 0
12 14 1 6
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
18 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
26 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
8 36 1 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.62Molecular Weight (Monoisotopic): 470.2682AlogP: 3.44#Rotatable Bonds: 7Polar Surface Area: 68.70Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.88CX Basic pKa: 10.56CX LogP: 3.17CX LogD: 0.25Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.55Np Likeness Score: -0.70
References 1. Harper BH, Wang L, Zhu C, Kar NF, Li B, Moyes CR, Goble SD, Costa M, Dingley K, Di Salvo J, Ha SN, Hurley A, Li X, Miller RR, Nagabukuro H, Salituro GM, Smith S, Struthers M, Hale JJ, Edmondson SD, Berger R.. (2017) Investigation of piperazine benzamides as human β3 adrenergic receptor agonists for the treatment of overactive bladder., 27 (4): [PMID:28089699 ] [10.1016/j.bmcl.2016.12.033 ]