The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Vibusambucin C ID: ALA4073175
PubChem CID: 137641052
Max Phase: Preclinical
Molecular Formula: C30H48O4
Molecular Weight: 472.71
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C/C(=C\CC[C@](C)(O)[C@H]1CC[C@]2(C)[C@@H]1CC[C@@H]1[C@@]3(C)CCC(=O)C(C)(C)[C@@H]3CC[C@]12C)C(=O)O
Standard InChI: InChI=1S/C30H48O4/c1-19(25(32)33)9-8-15-30(7,34)21-12-17-28(5)20(21)10-11-23-27(4)16-14-24(31)26(2,3)22(27)13-18-29(23,28)6/h9,20-23,34H,8,10-18H2,1-7H3,(H,32,33)/b19-9+/t20-,21+,22+,23-,27+,28-,29-,30+/m1/s1
Standard InChI Key: ZMEFMCJNMIYDNR-MEZLXJKYSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
6.1778 -6.4343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0433 -6.0068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0317 -7.6541 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.0397 -6.8325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7341 -7.9517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1996 -4.7821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9006 -7.2437 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3275 -7.2391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7556 -5.5926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9122 -7.9491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7486 -7.2441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6191 -6.0068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4690 -6.0177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4655 -6.8386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7610 -4.7651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3312 -5.5877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1860 -5.6093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9684 -5.8791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6191 -6.8325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4681 -5.2185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1945 -3.9530 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.4862 -4.3610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9903 -4.5380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4610 -5.1895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7484 -6.4176 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.0359 -5.1810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2563 -3.7602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0630 -3.6018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7159 -3.1409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6036 -4.2212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4101 -4.0627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9507 -4.6821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7573 -4.5236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6845 -5.4598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3005 -5.1409 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0260 -3.7439 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4648 -2.9601 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8093 -4.5378 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12 16 1 0
13 17 1 0
6 21 1 1
14 13 1 0
9 15 1 0
17 18 1 0
8 4 1 0
6 22 1 0
23 6 1 0
4 11 1 0
9 25 1 6
19 7 2 0
2 9 1 0
2 16 1 0
18 20 1 0
13 24 1 1
4 3 1 6
2 4 1 0
6 17 1 0
10 8 1 0
9 13 1 0
2 26 1 1
12 19 1 0
11 14 1 0
22 15 1 0
19 8 1 0
17 1 1 6
20 23 1 0
8 5 1 0
23 27 1 0
27 28 1 0
27 29 1 0
28 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
32 34 1 0
33 35 1 0
33 36 2 0
27 37 1 1
23 38 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 472.71Molecular Weight (Monoisotopic): 472.3553AlogP: 6.80#Rotatable Bonds: 5Polar Surface Area: 74.60Molecular Species: ACIDHBA: 3HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.39CX Basic pKa: ┄CX LogP: 6.60CX LogD: 3.70Aromatic Rings: ┄Heavy Atoms: 34QED Weighted: 0.43Np Likeness Score: 3.05
References 1. Nguyen TT, Truong BN, Doan Thi Mai H, Litaudon M, Nguyen VH, Do Thi T, Chau VM, Pham VC.. (2017) Cytotoxic dammarane-type triterpenoids from the leaves of Viburnum sambucinum., 27 (8): [PMID:28318944 ] [10.1016/j.bmcl.2017.03.014 ]