2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl 2-methylbenzoate

ID: ALA4073248

PubChem CID: 137640939

Max Phase: Preclinical

Molecular Formula: C14H15N3O4

Molecular Weight: 289.29

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccccc1C(=O)OCCn1c([N+](=O)[O-])cnc1C

Standard InChI:  InChI=1S/C14H15N3O4/c1-10-5-3-4-6-12(10)14(18)21-8-7-16-11(2)15-9-13(16)17(19)20/h3-6,9H,7-8H2,1-2H3

Standard InChI Key:  RXPAGFVKOJOGME-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 21 22  0  0  0  0  0  0  0  0999 V2000
    3.8001   -2.6828    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4545   -2.1935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1932   -1.4191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3735   -1.4300    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1346   -2.2105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8102   -3.4999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2369   -2.4361    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8373   -1.8817    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4168   -3.2332    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5229   -3.8997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5330   -4.7169    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2457   -5.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2559   -5.9338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9483   -4.6993    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3611   -2.4740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5525   -6.3462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5623   -7.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2756   -7.5631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9804   -7.1414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9672   -6.3264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6675   -5.9053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  1  6  1  0
  7  8  2  0
  7  9  1  0
  2  7  1  0
  6 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
  5 15  1  0
 13 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 13  1  0
 20 21  1  0
M  CHG  2   7   1   9  -1
M  END

Alternative Forms

  1. Parent:

    ALA4073248

    ---

Associated Targets(non-human)

GUSB Beta-glucuronidase (291 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 289.29Molecular Weight (Monoisotopic): 289.1063AlogP: 2.27#Rotatable Bonds: 5
Polar Surface Area: 87.26Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.27CX LogP: 2.55CX LogD: 2.55
Aromatic Rings: 2Heavy Atoms: 21QED Weighted: 0.48Np Likeness Score: -1.69

References

1. Salar U, Khan KM, Taha M, Ismail NH, Ali B, Qurat-Ul-Ain, Perveen S, Ghufran M, Wadood A..  (2017)  Biology-oriented drug synthesis (BIODS): In vitro β-glucuronidase inhibitory and in silico studies on 2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethyl aryl carboxylate derivatives.,  125  [PMID:27886546] [10.1016/j.ejmech.2016.11.031]

Source