2-(3-(2'-chlorobiphenyl-4-yl)propanamido)cyclohex-1-enecarboxylic acid

ID: ALA4073374

PubChem CID: 137641317

Max Phase: Preclinical

Molecular Formula: C22H22ClNO3

Molecular Weight: 383.88

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CCc1ccc(-c2ccccc2Cl)cc1)NC1=C(C(=O)O)CCCC1

Standard InChI:  InChI=1S/C22H22ClNO3/c23-19-7-3-1-5-17(19)16-12-9-15(10-13-16)11-14-21(25)24-20-8-4-2-6-18(20)22(26)27/h1,3,5,7,9-10,12-13H,2,4,6,8,11,14H2,(H,24,25)(H,26,27)

Standard InChI Key:  KKRSBZBQNMFHRN-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
    6.2067  -28.3811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9170  -27.9698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6304  -28.3757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3366  -27.9645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0499  -28.3704    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3335  -27.1432    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.7602  -27.9591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4703  -28.3698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1785  -27.9620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1797  -27.1404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4665  -26.7281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7521  -27.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4696  -29.1911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7573  -29.6032    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1810  -29.6045    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4954  -27.9738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7856  -28.3844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7883  -29.2066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5066  -29.6165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2135  -29.1994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0812  -29.6219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3670  -29.2111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6619  -29.6267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6656  -30.4489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3804  -30.8537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0867  -30.4399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8017  -30.8429    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  4  6  2  0
  5  7  1  0
  7  8  2  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
  8 13  1  0
 13 14  2  0
 13 15  1  0
  1 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20  1  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 18 21  1  0
 26 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4073374

    ---

Associated Targets(Human)

HCAR2 Tclin Hydroxycarboxylic acid receptor 2 (1903 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 383.88Molecular Weight (Monoisotopic): 383.1288AlogP: 4.97#Rotatable Bonds: 6
Polar Surface Area: 66.40Molecular Species: ACIDHBA: 2HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.36CX Basic pKa: CX LogP: 4.63CX LogD: 1.21
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.74Np Likeness Score: -0.47

References

1. Bobileva O, Ikaunieks M, Duburs G, Mandrika I, Petrovska R, Klovins J, Loza E..  (2017)  Synthesis and evaluation of (E)-2-(5-phenylpent-2-en-4-ynamido)cyclohex-1-ene-1-carboxylate derivatives as HCA2 receptor agonists.,  25  (16): [PMID:28668361] [10.1016/j.bmc.2017.06.028]

Source