The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl 2-[(4-{[5-(2-{[(4-Fluoro-3-methoxyphenyl)methyl]-carbamoyl}eth-1-yn-1-yl)-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-1-yl]methyl}phenyl)formamido]acetate ID: ALA4073452
PubChem CID: 137641127
Max Phase: Preclinical
Molecular Formula: C26H23FN4O7
Molecular Weight: 522.49
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)CNC(=O)c1ccc(Cn2cc(C#CC(=O)NCc3ccc(F)c(OC)c3)c(=O)[nH]c2=O)cc1
Standard InChI: InChI=1S/C26H23FN4O7/c1-37-21-11-17(5-9-20(21)27)12-28-22(32)10-8-19-15-31(26(36)30-25(19)35)14-16-3-6-18(7-4-16)24(34)29-13-23(33)38-2/h3-7,9,11,15H,12-14H2,1-2H3,(H,28,32)(H,29,34)(H,30,35,36)
Standard InChI Key: XFOXPTYPROZTRR-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 40 0 0 0 0 0 0 0 0999 V2000
23.4726 -18.1032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4726 -18.9265 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.1847 -19.3309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8864 -18.9265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8864 -18.1032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1847 -17.6884 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.5972 -19.3346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3076 -19.7506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7592 -17.6937 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.5999 -17.6937 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.0217 -20.1601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0182 -20.9793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.7309 -19.7525 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.4449 -20.1620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1583 -19.7586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8637 -20.1729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5722 -19.7664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5795 -18.9468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8652 -18.5321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1569 -18.9422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8674 -17.7150 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.7689 -19.3359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0577 -18.9282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0588 -18.1153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3530 -17.7077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6437 -18.1172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6469 -18.9406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3577 -19.3426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9352 -17.7099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9337 -16.8927 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.5762 -17.3083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2895 -18.5422 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19.2283 -18.1198 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.5198 -17.7126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8129 -18.1225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1044 -17.7153 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.8144 -18.9397 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1028 -16.8981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
4 7 1 0
7 8 3 0
1 9 2 0
5 10 2 0
8 11 1 0
11 12 2 0
11 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
19 21 1 0
2 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
26 29 1 0
29 30 2 0
21 31 1 0
18 32 1 0
29 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
35 37 2 0
36 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 522.49Molecular Weight (Monoisotopic): 522.1551AlogP: 0.30#Rotatable Bonds: 8Polar Surface Area: 148.59Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.49CX Basic pKa: ┄CX LogP: 0.98CX LogD: 0.97Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.28Np Likeness Score: -1.06
References 1. Senn N, Ott M, Lanz J, Riedl R.. (2017) Targeted Polypharmacology: Discovery of a Highly Potent Non-Hydroxamate Dual Matrix Metalloproteinase (MMP)-10/-13 Inhibitor., 60 (23): [PMID:28953404 ] [10.1021/acs.jmedchem.7b01001 ]