NA

ID: ALA4073537

PubChem CID: 137641064

Max Phase: Preclinical

Molecular Formula: C32H31NO4

Molecular Weight: 493.60

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1/C(=C/c2ccccc2)C[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CCCc2ccccc2)[C@H]1O5

Standard InChI:  InChI=1S/C32H31NO4/c34-25-14-13-23-19-26-32(36)20-24(18-22-10-5-2-6-11-22)28(35)30-31(32,27(23)29(25)37-30)15-17-33(26)16-7-12-21-8-3-1-4-9-21/h1-6,8-11,13-14,18,26,30,34,36H,7,12,15-17,19-20H2/b24-18+/t26-,30+,31+,32-/m1/s1

Standard InChI Key:  MNVBHTVEKDPEHG-FPXVUPNWSA-N

Molfile:  

     RDKit          2D

 39 45  0  0  0  0  0  0  0  0999 V2000
    6.5994  -23.9132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7905  -23.9132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0080  -23.2157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3943  -24.6065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9957  -24.6065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1578  -25.0894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5788  -22.5140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3943  -23.2157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8170  -23.2157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7905  -22.5140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5994  -21.7010    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1826  -23.2115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2256  -23.9173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8087  -24.6189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5812  -24.6065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1826  -22.2127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5812  -23.2157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1726  -23.9132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1644  -25.3205    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2132  -25.3288    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0039  -20.9828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9915  -25.5145    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.4166  -22.5017    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2804  -22.1054    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.0386  -23.9209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4462  -23.2191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2569  -23.2243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6685  -22.5233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2629  -21.8170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4456  -21.8161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0419  -22.5176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5932  -20.2829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9915  -19.5716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5808  -18.8716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9828  -18.1676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5728  -17.4681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7589  -17.4748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3568  -18.1869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7732  -18.8835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  2  2  0
  5  1  1  0
  6  5  1  0
  7  3  1  0
  8  2  1  0
  9  3  1  0
 10  7  1  0
 11 16  1  0
  1 12  1  1
 13 14  1  0
 14  5  1  0
 15  4  1  0
 16 12  1  0
 17  8  2  0
 18 17  1  0
 19 15  1  0
 14 20  2  0
 21 11  1  0
  5 22  1  1
  3 23  1  1
  7 24  1  6
  4  6  1  0
  7 11  1  0
  9 13  1  0
  8 10  1  0
 18 15  2  0
 13 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 21 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4073537

    ---

Associated Targets(Human)

OPRM1 Tclin Mu opioid receptor (19785 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
OPRK1 Tclin Kappa opioid receptor (16155 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
OPRD1 Tclin Delta opioid receptor (15096 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Oprd1 Delta opioid receptor (3911 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 493.60Molecular Weight (Monoisotopic): 493.2253AlogP: 4.44#Rotatable Bonds: 5
Polar Surface Area: 70.00Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 10.13CX Basic pKa: 9.09CX LogP: 5.06CX LogD: 3.64
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.51Np Likeness Score: 0.92

References

1. Healy JR, Bezawada P, Griggs NW, Devereaux AL, Matsumoto RR, Traynor JR, Coop A, Cunningham CW..  (2017)  Benzylideneoxymorphone: A new lead for development of bifunctional mu/delta opioid receptor ligands.,  27  (3): [PMID:28011222] [10.1016/j.bmcl.2016.11.057]

Source