The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4073537
PubChem CID: 137641064
Max Phase: Preclinical
Molecular Formula: C32H31NO4
Molecular Weight: 493.60
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C1/C(=C/c2ccccc2)C[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CCCc2ccccc2)[C@H]1O5
Standard InChI: InChI=1S/C32H31NO4/c34-25-14-13-23-19-26-32(36)20-24(18-22-10-5-2-6-11-22)28(35)30-31(32,27(23)29(25)37-30)15-17-33(26)16-7-12-21-8-3-1-4-9-21/h1-6,8-11,13-14,18,26,30,34,36H,7,12,15-17,19-20H2/b24-18+/t26-,30+,31+,32-/m1/s1
Standard InChI Key: MNVBHTVEKDPEHG-FPXVUPNWSA-N
Molfile:
RDKit 2D
39 45 0 0 0 0 0 0 0 0999 V2000
6.5994 -23.9132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7905 -23.9132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0080 -23.2157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3943 -24.6065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9957 -24.6065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1578 -25.0894 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5788 -22.5140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3943 -23.2157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8170 -23.2157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7905 -22.5140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5994 -21.7010 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1826 -23.2115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2256 -23.9173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8087 -24.6189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5812 -24.6065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1826 -22.2127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5812 -23.2157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1726 -23.9132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1644 -25.3205 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2132 -25.3288 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0039 -20.9828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9915 -25.5145 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.4166 -22.5017 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2804 -22.1054 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.0386 -23.9209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4462 -23.2191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2569 -23.2243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6685 -22.5233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2629 -21.8170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4456 -21.8161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0419 -22.5176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5932 -20.2829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9915 -19.5716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5808 -18.8716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9828 -18.1676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5728 -17.4681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7589 -17.4748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3568 -18.1869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7732 -18.8835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 2 2 0
5 1 1 0
6 5 1 0
7 3 1 0
8 2 1 0
9 3 1 0
10 7 1 0
11 16 1 0
1 12 1 1
13 14 1 0
14 5 1 0
15 4 1 0
16 12 1 0
17 8 2 0
18 17 1 0
19 15 1 0
14 20 2 0
21 11 1 0
5 22 1 1
3 23 1 1
7 24 1 6
4 6 1 0
7 11 1 0
9 13 1 0
8 10 1 0
18 15 2 0
13 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
21 32 1 0
32 33 1 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 493.60Molecular Weight (Monoisotopic): 493.2253AlogP: 4.44#Rotatable Bonds: 5Polar Surface Area: 70.00Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.13CX Basic pKa: 9.09CX LogP: 5.06CX LogD: 3.64Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.51Np Likeness Score: 0.92
References 1. Healy JR, Bezawada P, Griggs NW, Devereaux AL, Matsumoto RR, Traynor JR, Coop A, Cunningham CW.. (2017) Benzylideneoxymorphone: A new lead for development of bifunctional mu/delta opioid receptor ligands., 27 (3): [PMID:28011222 ] [10.1016/j.bmcl.2016.11.057 ]