3-(17,20-Diethyl-3,12-dioxo-13-oxa-4,11-diaza-tricyclo[14.2.2.1(6,10)]henicosa-1(19),6,8,10(21),16(20),17-hexaen-2-ylamino)-benzamide

ID: ALA4073823

PubChem CID: 57842686

Max Phase: Preclinical

Molecular Formula: C29H32N4O4

Molecular Weight: 500.60

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCc1cc2cc(CC)c1CCOC(=O)Nc1cccc(c1)CNC(=O)C2Nc1cccc(C(N)=O)c1

Standard InChI:  InChI=1S/C29H32N4O4/c1-3-19-14-22-15-20(4-2)25(19)11-12-37-29(36)33-23-9-5-7-18(13-23)17-31-28(35)26(22)32-24-10-6-8-21(16-24)27(30)34/h5-10,13-16,26,32H,3-4,11-12,17H2,1-2H3,(H2,30,34)(H,31,35)(H,33,36)

Standard InChI Key:  SVGMJSOPWWAAQA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
    5.4497  -10.8830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4481  -11.6643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1234  -12.0517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8010  -11.6636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8011  -10.8779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1208  -10.4916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4767  -12.0530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1547  -11.6604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8304  -12.0498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5043  -11.6572    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1800  -12.0467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8539  -11.6582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5297  -12.0438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2029  -11.6563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2017  -10.8730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5230  -10.4838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8498  -10.8788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5170   -9.7059    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8392   -9.3201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8374   -8.5381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4833   -7.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1457   -8.5443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1491   -9.3264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8256   -9.7170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8270  -10.4938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1529  -10.8825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4782  -10.5001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4719   -9.7211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1674   -9.7121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8281  -12.8277    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7728  -12.0545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0985  -11.6627    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7719  -12.8324    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7617   -9.3169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7567   -8.4997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5330   -9.3078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5323   -8.4906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 22 21  1  0
 23 22  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
  8 26  1  0
 27 26  1  0
 28 27  2  0
 23 28  1  0
 19 29  2  0
  9 30  2  0
  2 31  1  0
 31 32  1  0
 31 33  2  0
 28 34  1  0
 34 35  1  0
 24 36  1  0
 36 37  1  0
M  END

Associated Targets(Human)

F7 Tchem Coagulation factor VII (948 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 500.60Molecular Weight (Monoisotopic): 500.2424AlogP: 4.48#Rotatable Bonds: 5
Polar Surface Area: 122.55Molecular Species: NEUTRALHBA: 5HBD: 4
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.58CX Basic pKa: 0.41CX LogP: 4.67CX LogD: 4.67
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.41Np Likeness Score: 0.29

References

1. Wurtz NR, Parkhurst BL, DeLucca I, Glunz PW, Jiang W, Zhang X, Cheney DL, Bozarth JM, Rendina AR, Wei A, Harper T, Luettgen JM, Wu Y, Wong PC, Seiffert DA, Wexler RR, Priestley ES..  (2017)  Neutral macrocyclic factor VIIa inhibitors.,  27  (12): [PMID:28460818] [10.1016/j.bmcl.2017.04.008]

Source